1.0 2011-09-21 01:32:30 UTC 2015-07-21 06:59:17 UTC FDB027954 O-Phosphothreonine Phosphothreonine is a phosphoamino acid. It is the phosphorylated ester of threonine. There are three amino acids that are typically phosphorylated in eukaryotes: serine, threonine, and tyrosine. Threonine residues in endogenous proteins undergo phosphorylation through the action of a threonine kinase. Small amounts of free phosphothreonine can be detected in urine [PMID: 7693088]. [HMDB] (2S,3R)-2-amino-3-hydroxybutanoate (2S,3R)-2-amino-3-Hydroxybutanoate 3-ate (2S,3R)-2-amino-3-Hydroxybutanoic acid 3-ate (2S,3R)-2-amino-3-Hydroxybutanoic acid 3-ic acid (2S,3R)-2-amino-3-hydroxybutanoic acid 3-phosphate L-Threonine ate L-Threonine ic acid L-Threonine O-3-ate L-Threonine O-3-ic acid L-Threonine O-3-phosphate L-Threonine O-ate L-Threonine O-phosphate L-threonine phosphate O-L-Threonine O-O-L-Threonine O-ONO-L-Threonine O-phospho-L-threonine O-phosphono-L-threonine O3-Othreonine O3-phosphothreonine Othreonine Phosphothreonine Synonyms Sources Threonine ate ester Threonine ic acid ester threonine phosphate ester Threoninium dihydrogen ate Threoninium dihydrogen ic acid Threoninium dihydrogen phosphate C4H10NO6P 199.0991 199.024573569 (2S,3R)-2-amino-3-(phosphonooxy)butanoic acid phosphothreonine 1114-81-4 C[C@@H](OP(O)(O)=O)[C@H](N)C(O)=O InChI=1S/C4H10NO6P/c1-2(3(5)4(6)7)11-12(8,9)10/h2-3H,5H2,1H3,(H,6,7)(H2,8,9,10)/t2-,3+/m1/s1 USRGIUJOYOXOQJ-GBXIJSLDSA-N belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. L-alpha-amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Fatty acids and conjugates Hydrocarbon derivatives Monoalkyl phosphates Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Phosphoethanolamines Aliphatic acyclic compound Alkyl phosphate Amine Amino acid Carbonyl group Carboxylic acid Fatty acid Hydrocarbon derivative L-alpha-amino acid Monoalkyl phosphate Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organonitrogen compound Organooxygen compound Organopnictogen compound Phosphoethanolamine Phosphoric acid ester Primary aliphatic amine Primary amine L-threonine derivative O-phosphoamino acid non-proteinogenic L-alpha-amino acid Solid logp -1.86 ALOGPS logs -0.93 ALOGPS solubility 2.35e+01 g/l ALOGPS logp -2.7 ChemAxon pka_strongest_acidic 1.21 ChemAxon pka_strongest_basic 9.47 ChemAxon iupac (2S,3R)-2-amino-3-(phosphonooxy)butanoic acid ChemAxon average_mass 199.0991 ChemAxon mono_mass 199.024573569 ChemAxon smiles C[C@@H](OP(O)(O)=O)[C@H](N)C(O)=O ChemAxon formula C4H10NO6P ChemAxon inchi InChI=1S/C4H10NO6P/c1-2(3(5)4(6)7)11-12(8,9)10/h2-3H,5H2,1H3,(H,6,7)(H2,8,9,10)/t2-,3+/m1/s1 ChemAxon inchikey USRGIUJOYOXOQJ-GBXIJSLDSA-N ChemAxon polar_surface_area 130.08 ChemAxon refractivity 37.33 ChemAxon polarizability 15.43 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 23789 Specdb::CMs 39592 Specdb::CMs 138005 Specdb::CMs 145739 Specdb::MsMs 28613 Specdb::MsMs 28614 Specdb::MsMs 28615 Specdb::MsMs 35171 Specdb::MsMs 35172 Specdb::MsMs 35173 Specdb::MsMs 2757513 Specdb::MsMs 2757514 Specdb::MsMs 2757515 Specdb::MsMs 2947995 Specdb::MsMs 2947996 Specdb::MsMs 2947997 Specdb::MsIr 2510 Specdb::MsIr 2511 Specdb::MsIr 2512 Specdb::NmrOneD 93292 Specdb::NmrOneD 93293 Specdb::NmrOneD 93294 Specdb::NmrOneD 93295 Specdb::NmrOneD 93296 Specdb::NmrOneD 93297 Specdb::NmrOneD 93298 Specdb::NmrOneD 93299 Specdb::NmrOneD 93300 Specdb::NmrOneD 93301 Specdb::NmrOneD 93302 Specdb::NmrOneD 93303 Specdb::NmrOneD 93304 Specdb::NmrOneD 93305 Specdb::NmrOneD 93306 Specdb::NmrOneD 93307 Specdb::NmrOneD 93308 Specdb::NmrOneD 93309 Specdb::NmrOneD 93310 Specdb::NmrOneD 93311 HMDB11185 37525 TPO #<Reference:0x000055ce2f265860> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823