1.0 2011-09-21 01:36:50 UTC 2016-06-28 20:14:18 UTC FDB028249 MG(0:0/16:1(9Z)/0:0) MG(0:0/16:1(9Z)/0:0) belongs to the family of monoradyglycerols, which are glycerolipids lipids containing a common glycerol backbone to which at one fatty acyl group is attached. Their general formula is [R1]OCC(CO[R2])O[R3]. MG(0:0/16:1(9Z)/0:0) is made up of one 9Z-hexadecenoyl(R2). 2-(9Z-hexadecenoyl)-rac-glycerol 2-palmitoleoyl-glycerol MAG(0:0/16:1) MAG(0:0/16:1n7) MAG(0:0/16:1w7) MAG(16:1) MG(0:0/16:1) MG(0:0/16:1n7) MG(0:0/16:1w7) MG(16:1) C19H36O4 328.4867 328.26135964 1,3-dihydroxypropan-2-yl hexadec-9-enoate 1,3-dihydroxypropan-2-yl hexadec-9-enoate CCCCCCC=CCCCCCCCC(=O)OC(CO)CO InChI=1S/C19H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-18(16-20)17-21/h7-8,18,20-21H,2-6,9-17H2,1H3 CXUXMSACCLYMBI-UHFFFAOYSA-N belongs to the class of organic compounds known as 2-monoacylglycerols. These are monoacylglycerols containing a glycerol acylated at the 2-position. 2-monoacylglycerols Organic compounds Lipids and lipid-like molecules Glycerolipids Monoradylglycerols Aliphatic acyclic compounds Carbonyl compounds Carboxylic acid esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Primary alcohols 2-acyl-sn-glycerol Alcohol Aliphatic acyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Primary alcohol Solid logp 5.22 ALOGPS logs -4.65 ALOGPS solubility 7.28e-03 g/l ALOGPS logp 4.72 ChemAxon pka_strongest_acidic 14.28 ChemAxon pka_strongest_basic -3 ChemAxon iupac 1,3-dihydroxypropan-2-yl hexadec-9-enoate ChemAxon average_mass 328.4867 ChemAxon mono_mass 328.26135964 ChemAxon smiles CCCCCCC=CCCCCCCCC(=O)OC(CO)CO ChemAxon formula C19H36O4 ChemAxon inchi InChI=1S/C19H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-18(16-20)17-21/h7-8,18,20-21H,2-6,9-17H2,1H3 ChemAxon inchikey CXUXMSACCLYMBI-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 95.22 ChemAxon polarizability 41.34 ChemAxon rotatable_bond_count 17 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon HMDB11534 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 2-acylglycerol O-acyltransferase 1 Q96PD6 MOGAT1 2-acylglycerol O-acyltransferase 2 Q3SYC2 MOGAT2 2-acylglycerol O-acyltransferase 3 Q86VF5 MOGAT3 Ectonucleotide pyrophosphatase/phosphodiesterase family member 6 Q6UWR7 ENPP6 Lysophosphatidic acid phosphatase type 6 Q9NPH0 ACP6 Monoglyceride lipase Q99685 MGLL