1.0 2011-09-21 01:38:00 UTC 2025-11-19 02:55:01 UTC FDB028326 D-Dopachrome D-dopachrome is reversibly converted to 5,6-dihydroxyindole and carbon dioxide via the enzyme D-dopachrome decarboxylase (EC 4.1.1.84). (KEGG) Cultured human melanoma cells contain this enzyme as well as human liver. (PMID 8267597) [HMDB] (2R)-2,3,5,6-tetrahydro-5,6-dioxo-1H-Indole-2-carboxylic acid (R)2,3,5,6-tetrahydro-5,6-dioxo--1H-Indole-2-carboxylic acid 2,3,5,6-Tetrahydro-5,6-dioxo-1H-indole-2-carboxylate 2,3,5,6-Tetrahydro-5,6-dioxo-1H-indole-2-carboxylic acid D-Dopachrome C9H7NO4 193.1562 193.037507717 5,6-dioxo-2,3,5,6-tetrahydro-1H-indole-2-carboxylic acid dopachrome 203000-17-3 OC(=O)C1CC2=CC(=O)C(=O)C=C2N1 InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h2-3,6,10H,1H2,(H,13,14) VJNCICVKUHKIIV-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteropolycyclic compounds Amino acids Azacyclic compounds Carboxylic acids Cyclic ketones Dialkylamines Enamines Hydrocarbon derivatives Indolines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Pyrrolidine carboxylic acids Vinylogous amides Aliphatic heteropolycyclic compound Alpha-amino acid Amine Amino acid Azacycle Carbonyl group Carboxylic acid Cyclic ketone Dihydroindole Enamine Hydrocarbon derivative Indole or derivatives Ketone Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrolidine Pyrrolidine carboxylic acid Pyrrolidine carboxylic acid or derivatives Secondary aliphatic amine Secondary amine Vinylogous amide quinone Solid logp 0.22 ALOGPS logs -1.28 ALOGPS solubility 1.02e+01 g/l ALOGPS logp -0.087 ChemAxon pka_strongest_acidic 3.67 ChemAxon pka_strongest_basic -8.8 ChemAxon iupac 5,6-dioxo-2,3,5,6-tetrahydro-1H-indole-2-carboxylic acid ChemAxon average_mass 193.1562 ChemAxon mono_mass 193.037507717 ChemAxon smiles OC(=O)C1CC2=CC(=O)C(=O)C=C2N1 ChemAxon formula C9H7NO4 ChemAxon inchi InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h2-3,6,10H,1H2,(H,13,14) ChemAxon inchikey VJNCICVKUHKIIV-UHFFFAOYSA-N ChemAxon polar_surface_area 83.47 ChemAxon refractivity 47.88 ChemAxon polarizability 17.48 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 24657 Specdb::CMs 39725 Specdb::MsMs 320602 Specdb::MsMs 320603 Specdb::MsMs 320604 Specdb::MsMs 368008 Specdb::MsMs 368009 Specdb::MsMs 368010 HMDB11622 49109 #<Reference:0x000055ce318e8eb0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 D-dopachrome decarboxylase P30046 DDT