1.0 2011-09-21 01:38:31 UTC 2015-07-21 06:59:23 UTC FDB028355 3-Methylene-indolenine 3-Methylene-indolenine is an electrophilic molecule produced by the action of cytochrome P450 2F1 on 3-methylindole (3MI). 3-Methylindole (3MI) is a naturally occurring pulmonary toxin that requires metabolic activation. In particular, 3MI-induced pneumotoxicity arises from cytochrome P-450-catalyzed dehydrogenation of 3MI to an electrophilic methylene imine (3-methyleneindolenine), which covalently binds to cellular macromolecules. Members of the CYP2F gene subfamily are selectively expressed in lung tissues and have been implicated as important catalysts in the formation of reactive intermediates from several pneumotoxic chemicals. (PMID: 10383923) [HMDB] 3-methylene-3H-Indole 3-Methyleneindolenine C9H7N 129.1586 129.057849229 3-methylidene-3H-indole 3-methyleneindolenine 40642-83-9 C=C1C=NC2=CC=CC=C12 InChI=1S/C9H7N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H2 BCNUXXXHEIUHJB-UHFFFAOYSA-N belongs to the class of organic compounds known as indoles and derivatives. These are organic compounds containing an indole, which is a bicyclic ring system made up of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. Indoles and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Aromatic heteropolycyclic compounds Azacyclic compounds Benzenoids Hydrocarbon derivatives Imines Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Aromatic heteropolycyclic compound Azacycle Benzenoid Hydrocarbon derivative Imine Indole or derivatives Organic 1,3-dipolar compound Organic nitrogen compound Organonitrogen compound Organopnictogen compound Propargyl-type 1,3-dipolar organic compound indoles Solid logp 2.40 ALOGPS logs -2.74 ALOGPS solubility 2.36e-01 g/l ALOGPS logp 2.23 ChemAxon pka_strongest_basic 5.31 ChemAxon iupac 3-methylidene-3H-indole ChemAxon average_mass 129.1586 ChemAxon mono_mass 129.057849229 ChemAxon smiles C=C1C=NC2=CC=CC=C12 ChemAxon formula C9H7N ChemAxon inchi InChI=1S/C9H7N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H2 ChemAxon inchikey BCNUXXXHEIUHJB-UHFFFAOYSA-N ChemAxon polar_surface_area 12.36 ChemAxon refractivity 43.51 ChemAxon polarizability 14.08 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2565 Specdb::MsIr 2566 Specdb::CMs 17269 Specdb::CMs 173838 Specdb::MsMs 304174 Specdb::MsMs 304175 Specdb::MsMs 304176 Specdb::MsMs 347299 Specdb::MsMs 347300 Specdb::MsMs 347301 Specdb::MsMs 2722350 Specdb::MsMs 2722351 Specdb::MsMs 2722352 Specdb::MsMs 2959920 Specdb::MsMs 2959921 Specdb::MsMs 2959922 HMDB11664 #<Reference:0x000055ce3229e6a8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823