1.0 2011-09-21 01:38:42 UTC 2017-04-03 05:02:18 UTC FDB028369 Inosine 2'-phosphate Inosine 2'-phosphate is an inosine nucleotide containing a pyrophosphate group esterified to C2 of the sugar moiety. Inosine 2'-phosphate is a product of 2',3'-cyclic-nucleotide 3'-phosphodiesterase (EC 3.1.4.37). This enzyme (also called CNP) catalyzes the chemical reaction: nucleoside 2',3'-cyclic phosphate + H2O <-> nucleoside 2'-phosphate. 2',3'-cyclic nucleotide 3'-phosphodiesterase is a myelin-associated enzyme that makes up 4% of total CNS myelin protein, and is thought to undergo significant age-associated changes. The absence of CNP causes axonal swelling and neuronal degeneration. [HMDB] 2' Inosine monoate 2' Inosine monophosphate 2'-IMP Inosine 2'-monoate Inosine 2'-monophosphate C10H13N4O8P 348.206 348.047099924 {[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(6-oxo-6,9-dihydro-3H-purin-9-yl)oxolan-3-yl]oxy}phosphonic acid [(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(6-oxo-3H-purin-9-yl)oxolan-3-yl]oxyphosphonic acid 58-63-9 OC[C@H]1O[C@H]([C@H](OP(O)(O)=O)[C@@H]1O)N1C=NC2=C1NC=NC2=O InChI=1S/C10H13N4O8P/c15-1-4-6(16)7(22-23(18,19)20)10(21-4)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,11,12,17)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 PGZVUSPTYXQADT-KQYNXXCUSA-N belongs to the class of organic compounds known as pentose phosphates. These are carbohydrate derivatives containing a pentose substituted by one or more phosphate groups. Pentose phosphates Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aromatic heteropolycyclic compounds 6-oxopurines Azacyclic compounds Glycosylamines Heteroaromatic compounds Hydrocarbon derivatives Hypoxanthines Monoalkyl phosphates N-substituted imidazoles Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Primary alcohols Pyrimidones Secondary alcohols Tetrahydrofurans Vinylogous amides 6-oxopurine Alcohol Alkyl phosphate Aromatic heteropolycyclic compound Azacycle Azole Glycosyl compound Heteroaromatic compound Hydrocarbon derivative Hypoxanthine Imidazole Imidazopyrimidine Monoalkyl phosphate N-glycosyl compound N-substituted imidazole Organic nitrogen compound Organic oxide Organic phosphoric acid derivative Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Pentose phosphate Phosphoric acid ester Primary alcohol Purine Pyrimidine Pyrimidone Secondary alcohol Tetrahydrofuran Vinylogous amide Solid logp -1.54 ALOGPS logs -2.03 ALOGPS solubility 3.23e+00 g/l ALOGPS logp -3.9 ChemAxon pka_strongest_acidic 0.68 ChemAxon pka_strongest_basic 2.74 ChemAxon iupac {[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-2-(6-oxo-6,9-dihydro-3H-purin-9-yl)oxolan-3-yl]oxy}phosphonic acid ChemAxon average_mass 348.206 ChemAxon mono_mass 348.047099924 ChemAxon smiles OC[C@H]1O[C@H]([C@H](OP(O)(O)=O)[C@@H]1O)N1C=NC2=C1NC=NC2=O ChemAxon formula C10H13N4O8P ChemAxon inchi InChI=1S/C10H13N4O8P/c15-1-4-6(16)7(22-23(18,19)20)10(21-4)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,11,12,17)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 ChemAxon inchikey PGZVUSPTYXQADT-KQYNXXCUSA-N ChemAxon polar_surface_area 175.73 ChemAxon refractivity 71.77 ChemAxon polarizability 28.69 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 10 ChemAxon donor_count 5 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12694 Specdb::CMs 39763 Specdb::CMs 172101 Specdb::NmrOneD 93952 Specdb::NmrOneD 93953 Specdb::NmrOneD 93954 Specdb::NmrOneD 93955 Specdb::NmrOneD 93956 Specdb::NmrOneD 93957 Specdb::NmrOneD 93958 Specdb::NmrOneD 93959 Specdb::NmrOneD 93960 Specdb::NmrOneD 93961 Specdb::NmrOneD 93962 Specdb::NmrOneD 93963 Specdb::NmrOneD 93964 Specdb::NmrOneD 93965 Specdb::NmrOneD 93966 Specdb::NmrOneD 93967 Specdb::NmrOneD 93968 Specdb::NmrOneD 93969 Specdb::NmrOneD 93970 Specdb::NmrOneD 93971 Specdb::MsMs 293887 Specdb::MsMs 293888 Specdb::MsMs 293889 Specdb::MsMs 334474 Specdb::MsMs 334475 Specdb::MsMs 334476 Specdb::MsMs 2443918 Specdb::MsMs 2443919 Specdb::MsMs 2443920 Specdb::MsMs 2522028 Specdb::MsMs 2522029 Specdb::MsMs 2522030 HMDB11681 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 2',3'-cyclic-nucleotide 3'-phosphodiesterase P09543 CNP