1.0 2011-09-21 01:38:46 UTC 2015-07-21 06:59:24 UTC FDB028374 Phenylbutyrylglutamine Phenylbutyrylglutamine has been identified as a new metabolite of phenylbutyrate in human plasma and urine. Phenylbutyrate is used in humans for treating inborn errors of ureagenesis, certain forms of cancer, cystic fibrosis and thalassemia. After administration of phenylbutyrate to normal humans, the cumulative urinary excretion of phenylacetate, phenylbutyrate, phenylacetylglutamine and phenylbutyrylglutamine amounts to about half of the dose of phenylbutyrate. [HMDB] C15H20N2O4 292.3303 292.142307138 4-carbamoyl-2-(4-phenylbutanamido)butanoic acid 4-carbamoyl-2-(4-phenylbutanamido)butanoic acid NC(=O)CCC(NC(=O)CCCC1=CC=CC=C1)C(O)=O InChI=1S/C15H20N2O4/c16-13(18)10-9-12(15(20)21)17-14(19)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H2,16,18)(H,17,19)(H,20,21) XKQKXKRCMAJADR-UHFFFAOYSA-N belongs to the class of organic compounds known as glutamine and derivatives. Glutamine and derivatives are compounds containing glutamine or a derivative thereof resulting from reaction of glutamine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Glutamine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Benzene and substituted derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives N-acyl amines N-acyl-alpha amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Primary carboxylic acid amides Secondary carboxylic acid amides Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid Fatty acyl Fatty amide Glutamine or derivatives Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary carboxylic acid amide Secondary carboxylic acid amide Solid logp 0.65 ALOGPS logs -3.55 ALOGPS solubility 8.15e-02 g/l ALOGPS logp 0.8 ChemAxon pka_strongest_acidic 3.87 ChemAxon pka_strongest_basic -0.56 ChemAxon iupac 4-carbamoyl-2-(4-phenylbutanamido)butanoic acid ChemAxon average_mass 292.3303 ChemAxon mono_mass 292.142307138 ChemAxon smiles NC(=O)CCC(NC(=O)CCCC1=CC=CC=C1)C(O)=O ChemAxon formula C15H20N2O4 ChemAxon inchi InChI=1S/C15H20N2O4/c16-13(18)10-9-12(15(20)21)17-14(19)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H2,16,18)(H,17,19)(H,20,21) ChemAxon inchikey XKQKXKRCMAJADR-UHFFFAOYSA-N ChemAxon polar_surface_area 109.49 ChemAxon refractivity 76.48 ChemAxon polarizability 30.51 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22573 Specdb::CMs 39766 Specdb::CMs 148978 Specdb::MsMs 316129 Specdb::MsMs 316130 Specdb::MsMs 316131 Specdb::MsMs 362302 Specdb::MsMs 362303 Specdb::MsMs 362304 Specdb::MsMs 2252459 Specdb::MsMs 2254016 Specdb::MsMs 2702002 Specdb::MsMs 2702003 Specdb::MsMs 2702004 Specdb::MsMs 3006522 Specdb::MsMs 3006523 Specdb::MsMs 3006524 HMDB11687 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823