1.0 2011-09-21 01:38:51 UTC 2015-07-21 06:59:24 UTC FDB028379 Cytidine 2'-phosphate Cytidine 2'-phosphate is a cytidine nucleotide containing a phosphate group esterified to C2 of the sugar moiety. Cytidine 2'-phosphate is a product of 2',3'-cyclic-nucleotide 3'-phosphodiesterase (EC 3.1.4.37). This enzyme (also called CNP) catalyzes the chemical reaction: nucleoside 2',3'-cyclic phosphate + H2O <-> nucleoside 2'-phosphate. 2',3'-cyclic nucleotide 3'-phosphodiesterase is a myelin-associated enzyme that makes up 4% of total CNS myelin protein, and is thought to undergo significant age-associated changes. The absence of CNP causes axonal swelling and neuronal degeneration. [HMDB] 2'-CMP 2'-Cytidylic acid Cytidine 2'-monoate Cytidine 2'-monophosphate C9H14N3O8P 323.1965 323.051850951 {[(3R,4R,5R)-2-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy}phosphonic acid [(3R,4R,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxyphosphonic acid 85-94-9 NC1=NC(=O)N(C=C1)C1O[C@H](CO)[C@@H](O)[C@H]1OP(O)(O)=O InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(20-21(16,17)18)6(14)4(3-13)19-8/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8?/m1/s1 YQUAKORMLHPSLZ-ZRTZXPPTSA-N belongs to the class of organic compounds known as pentose phosphates. These are carbohydrate derivatives containing a pentose substituted by one or more phosphate groups. Pentose phosphates Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aromatic heteromonocyclic compounds Aminopyrimidines and derivatives Azacyclic compounds Glycosylamines Heteroaromatic compounds Hydrocarbon derivatives Hydropyrimidines Imidolactams Monoalkyl phosphates Organic oxides Organopnictogen compounds Oxacyclic compounds Primary alcohols Primary amines Pyrimidones Secondary alcohols Tetrahydrofurans Alcohol Alkyl phosphate Amine Aminopyrimidine Aromatic heteromonocyclic compound Azacycle Glycosyl compound Heteroaromatic compound Hydrocarbon derivative Hydropyrimidine Imidolactam Monoalkyl phosphate N-glycosyl compound Organic nitrogen compound Organic oxide Organic phosphoric acid derivative Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Pentose phosphate Phosphoric acid ester Primary alcohol Primary amine Pyrimidine Pyrimidone Secondary alcohol Tetrahydrofuran Solid logp -1.98 ALOGPS logs -1.27 ALOGPS solubility 1.74e+01 g/l ALOGPS logp -3.5 ChemAxon pka_strongest_acidic 0.75 ChemAxon pka_strongest_basic -0.65 ChemAxon iupac {[(3R,4R,5R)-2-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy}phosphonic acid ChemAxon average_mass 323.1965 ChemAxon mono_mass 323.051850951 ChemAxon smiles NC1=NC(=O)N(C=C1)C1O[C@H](CO)[C@@H](O)[C@H]1OP(O)(O)=O ChemAxon formula C9H14N3O8P ChemAxon inchi InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(20-21(16,17)18)6(14)4(3-13)19-8/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8?/m1/s1 ChemAxon inchikey YQUAKORMLHPSLZ-ZRTZXPPTSA-N ChemAxon polar_surface_area 175.14 ChemAxon refractivity 65.42 ChemAxon polarizability 26.84 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 9 ChemAxon donor_count 5 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 306184 Specdb::MsMs 306185 Specdb::MsMs 306186 Specdb::MsMs 349735 Specdb::MsMs 349736 Specdb::MsMs 349737 Specdb::MsMs 2349937 Specdb::MsMs 2349938 Specdb::MsMs 2349939 Specdb::MsMs 2589295 Specdb::MsMs 2589296 Specdb::MsMs 2589297 Specdb::CMs 18128 Specdb::CMs 39769 Specdb::CMs 160634 Specdb::NmrOneD 94072 Specdb::NmrOneD 94073 Specdb::NmrOneD 94074 Specdb::NmrOneD 94075 Specdb::NmrOneD 94076 Specdb::NmrOneD 94077 Specdb::NmrOneD 94078 Specdb::NmrOneD 94079 Specdb::NmrOneD 94080 Specdb::NmrOneD 94081 Specdb::NmrOneD 94082 Specdb::NmrOneD 94083 Specdb::NmrOneD 94084 Specdb::NmrOneD 94085 Specdb::NmrOneD 94086 Specdb::NmrOneD 94087 Specdb::NmrOneD 94088 Specdb::NmrOneD 94089 Specdb::NmrOneD 94090 Specdb::NmrOneD 94091 HMDB11692 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 2',3'-cyclic-nucleotide 3'-phosphodiesterase P09543 CNP