1.0 2011-09-21 01:39:28 UTC 2018-05-28 18:38:13 UTC FDB028416 gamma-Glutamylglutamine gamma-Glutamylglutamine has been identified in plasma and cerebrospinal fluid from hyperammonaemic patients. [HMDB] g-L-Glu-L-gln gamma-Glu-Gln gamma-Glutamylglutamine gamma-L-Glu-L-gln N-L-gamma-Glutamyl-L-glutamine γ-L-glu-L-gln C10H17N3O6 275.2585 275.111735291 (2S)-2-[(4S)-4-amino-4-carboxybutanamido]-4-carbamoylbutanoic acid (2S)-2-[(4S)-4-amino-4-carboxybutanamido]-4-carbamoylbutanoic acid 10148-81-9 N[C@@H](CCC(=O)N[C@@H](CCC(N)=O)C(O)=O)C(O)=O InChI=1S/C10H17N3O6/c11-5(9(16)17)1-4-8(15)13-6(10(18)19)2-3-7(12)14/h5-6H,1-4,11H2,(H2,12,14)(H,13,15)(H,16,17)(H,18,19)/t5-,6-/m0/s1 JBFYFLXEJFQWMU-WDSKDSINSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Gamma-glutamyl amino acids Glutamine and derivatives Hydrocarbon derivatives L-alpha-amino acids Monoalkylamines N-acyl amines N-acyl-L-glutamines Organic oxides Organopnictogen compounds Primary carboxylic acid amides Secondary carboxylic acid amides Aliphatic acyclic compound Alpha-amino acid Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Fatty amide Gamma-glutamyl alpha-amino acid Glutamine or derivatives Hydrocarbon derivative L-alpha-amino acid N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine N-acyl-l-alpha-amino acid N-acyl-l-glutamine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Primary carboxylic acid amide Secondary carboxylic acid amide dipeptide Solid logp -3.56 ALOGPS logs -1.65 ALOGPS solubility 6.17e+00 g/l ALOGPS logp -5 ChemAxon pka_strongest_acidic 1.93 ChemAxon pka_strongest_basic 9.31 ChemAxon iupac (2S)-2-[(4S)-4-amino-4-carboxybutanamido]-4-carbamoylbutanoic acid ChemAxon average_mass 275.2585 ChemAxon mono_mass 275.111735291 ChemAxon smiles N[C@@H](CCC(=O)N[C@@H](CCC(N)=O)C(O)=O)C(O)=O ChemAxon formula C10H17N3O6 ChemAxon inchi InChI=1S/C10H17N3O6/c11-5(9(16)17)1-4-8(15)13-6(10(18)19)2-3-7(12)14/h5-6H,1-4,11H2,(H2,12,14)(H,13,15)(H,16,17)(H,18,19)/t5-,6-/m0/s1 ChemAxon inchikey JBFYFLXEJFQWMU-WDSKDSINSA-N ChemAxon polar_surface_area 172.81 ChemAxon refractivity 61.2 ChemAxon polarizability 26.12 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 7 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 21394 Specdb::CMs 39787 Specdb::CMs 157587 Specdb::NmrOneD 151010 Specdb::NmrOneD 151011 Specdb::NmrOneD 151012 Specdb::NmrOneD 151013 Specdb::NmrOneD 151014 Specdb::NmrOneD 151015 Specdb::NmrOneD 151016 Specdb::NmrOneD 151017 Specdb::NmrOneD 151018 Specdb::NmrOneD 151019 Specdb::NmrOneD 151020 Specdb::NmrOneD 151021 Specdb::NmrOneD 151022 Specdb::NmrOneD 151023 Specdb::NmrOneD 151024 Specdb::NmrOneD 151025 Specdb::NmrOneD 151026 Specdb::NmrOneD 151027 Specdb::NmrOneD 151028 Specdb::NmrOneD 151029 Specdb::MsMs 313594 Specdb::MsMs 313595 Specdb::MsMs 313596 Specdb::MsMs 359116 Specdb::MsMs 359117 Specdb::MsMs 359118 Specdb::MsMs 447356 Specdb::MsMs 2244301 Specdb::MsMs 2245784 Specdb::MsMs 2437645 Specdb::MsMs 2437646 Specdb::MsMs 2437647 Specdb::MsMs 2527608 Specdb::MsMs 2527609 Specdb::MsMs 2527610 HMDB11738 #<Reference:0x00007f093c059320> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823