1.0 2011-09-21 01:45:15 UTC 2015-07-21 06:59:32 UTC FDB028808 2-Keto-6-aminocaproate 2-Keto-6-aminocaproate is an intermediate in lysine degradation and can be formed from L-lysine. L-Lysine is an essential amino-acid that is a necessary building block for all protein in the body. L-Lysine plays a major role in calcium absorption; building muscle protein; recovering from surgery or sports injuries; and the body's production of hormones, enzymes, and antibodies. L-Lysine can be converted to 2-keto-6-aminocaproate via the enzyme L-lysine alpha-oxidase. 2-Keto-6-aminocaproate can spontaneously decarboxylate to 5-aminovalerate in the presence of the reaction product, hydrogen peroxide. It can also be spontaneously converted in solution to its cyclic form delta-piperideine-2-carboxylate. This has been demonstrated in vitro in the presence of catalase, which splits hydrogen peroxide. [HMDB] 2-Keto-6-amino-caproate 2-Keto-6-amino-caproic acid 2-oxo-6-aminocaproate 2-oxo-6-aminocaproic acid 2-oxo-6-aminohexanoate 2-oxo-6-aminohexanoic acid 6-amino-2-oxohexanoate 6-amino-2-oxohexanoic acid alpha-keto-epsilon-aminocaproate alpha-keto-epsilon-aminocaproic acid alpha-keto-epsilon-aminohexanoate alpha-keto-epsilon-aminohexanoic acid alpha-ketolysine C6H11NO3 145.1564 145.073893223 6-amino-2-oxohexanoic acid 6-amino-2-oxohexanoic acid NCCCCC(=O)C(O)=O InChI=1S/C6H11NO3/c7-4-2-1-3-5(8)6(9)10/h1-4,7H2,(H,9,10) GWENQMVPLJAMAE-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain keto acids and derivatives. These are keto acids with a 6 to 12 carbon atoms long side chain. Medium-chain keto acids and derivatives Organic compounds Organic acids and derivatives Keto acids and derivatives Medium-chain keto acids and derivatives Aliphatic acyclic compounds Alpha-hydroxy ketones Alpha-keto acids and derivatives Amino acids Amino fatty acids Carboxylic acids Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-hydroxy ketone Alpha-keto acid Amine Amino acid Amino acid or derivatives Amino fatty acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acyl Hydrocarbon derivative Ketone Medium-chain keto acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine 2-oxo monocarboxylic acid epsilon-amino acid Solid logp -2.26 ALOGPS logs -0.93 ALOGPS solubility 1.71e+01 g/l ALOGPS logp -2.2 ChemAxon pka_strongest_acidic 3.24 ChemAxon pka_strongest_basic 10.01 ChemAxon iupac 6-amino-2-oxohexanoic acid ChemAxon average_mass 145.1564 ChemAxon mono_mass 145.073893223 ChemAxon smiles NCCCCC(=O)C(O)=O ChemAxon formula C6H11NO3 ChemAxon inchi InChI=1S/C6H11NO3/c7-4-2-1-3-5(8)6(9)10/h1-4,7H2,(H,9,10) ChemAxon inchikey GWENQMVPLJAMAE-UHFFFAOYSA-N ChemAxon polar_surface_area 80.39 ChemAxon refractivity 35.4 ChemAxon polarizability 14.62 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 26252 Specdb::CMs 39835 Specdb::CMs 146547 Specdb::NmrOneD 151310 Specdb::NmrOneD 151311 Specdb::NmrOneD 151312 Specdb::NmrOneD 151313 Specdb::NmrOneD 151314 Specdb::NmrOneD 151315 Specdb::NmrOneD 151316 Specdb::NmrOneD 151317 Specdb::NmrOneD 151318 Specdb::NmrOneD 151319 Specdb::NmrOneD 151320 Specdb::NmrOneD 151321 Specdb::NmrOneD 151322 Specdb::NmrOneD 151323 Specdb::NmrOneD 151324 Specdb::NmrOneD 151325 Specdb::NmrOneD 151326 Specdb::NmrOneD 151327 Specdb::NmrOneD 151328 Specdb::NmrOneD 151329 Specdb::MsIr 2666 Specdb::MsIr 2667 Specdb::MsIr 2668 Specdb::MsMs 324166 Specdb::MsMs 324167 Specdb::MsMs 324168 Specdb::MsMs 372514 Specdb::MsMs 372515 Specdb::MsMs 372516 Specdb::MsMs 2713282 Specdb::MsMs 2713283 Specdb::MsMs 2713284 Specdb::MsMs 2966049 Specdb::MsMs 2966050 Specdb::MsMs 2966051 HMDB12151 17534 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823