1.0 2011-09-21 01:45:16 UTC 2017-04-03 05:02:18 UTC FDB028809 2-O-(6-Phospho-alpha-mannosyl)-D-glycerate 2-O-(6-Phospho-alpha-mannosyl)-D-glycerate is an alpha-D-mannosylglycerate (MG) that is an intermediate in 2-O-alpha-mannosyl-D-glycerate degradation. It can be generated from 2-O-alpha-mannosyl-D-glycerate via the enzyme 2-O-alpha-mannosyl-D-glycerate transporting phosphotransferase system (mngA). 2-O-Alpha-mannosyl-D-glycerate is a natural extremolyte identified in microorganisms growing under extremely high temperatures up to 100 oC, and had been shown to protect proteins against various stress conditions such as heat, freezing, thawing, and drying. MG that is naturally occurring hyperthermophilic osmolytes, could be potential drug candidates or lead compounds against alpha,beta aggregation associated with Alzheimer's disease(PMID: 18304694). In most organisms MG is produced from guanosine pyrophosphate mannose (GDP-alpha-D-mannose) via mannosyl-3-phosphoglycerate in two steps, catalyzed by the enzymes mannosyl-3-phosphoglycerate synthase and mannosyl-3-phosphoglycerate phosphatase. [HMDB] 2-O-(6-O-a-D-Mannosyl)-D-glycerate 2-O-(6-O-a-D-Mannosyl)-D-glyceric acid 2-O-(6-O-a-Mannosyl)-D-glycerate 2-O-(6-O-a-Mannosyl)-D-glyceric acid 2-O-(6-O-alpha-D-Mannosyl)-D-glycerate 2-O-(6-O-alpha-D-Mannosyl)-D-glyceric acid 2-O-(6-O-alpha-Mannosyl)-D-glyceric acid 2-O-(6-O-alpha-Mannosyl)-delta-glycerate 2-O-(6-O-alpha-Mannosyl)-delta-glyceric acid 2-O-(6-O-α-D-mannosyl)-D-glycerate 2-O-(6-O-α-D-mannosyl)-D-glyceric acid 2-O-(6-Phospho-a-mannosyl)-D-glycerate 2-O-(6-Phospho-a-mannosyl)-D-glyceric acid 2-O-(6-Phospho-alpha-mannosyl)-D-glyceric acid 2-O-(6-Phospho-alpha-mannosyl)-delta-glycerate 2-O-(6-Phospho-alpha-mannosyl)-delta-glyceric acid C9H17O12P 348.1978 348.04576252 (2R)-3-hydroxy-2-{[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-[(phosphonooxy)methyl]oxan-2-yl]oxy}propanoic acid (2R)-3-hydroxy-2-{[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-[(phosphonooxy)methyl]oxan-2-yl]oxy}propanoic acid 302-72-7 OC[C@@H](O[C@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@@H]1O)C(O)=O InChI=1S/C9H17O12P/c10-1-3(8(14)15)20-9-7(13)6(12)5(11)4(21-9)2-19-22(16,17)18/h3-7,9-13H,1-2H2,(H,14,15)(H2,16,17,18)/t3-,4-,5-,6+,7+,9+/m1/s1 BOLXAGHGKNGVBE-MTXRGOKVSA-N belongs to the class of organic compounds known as hexose phosphates. These are carbohydrate derivatives containing a hexose substituted by one or more phosphate groups. Hexose phosphates Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Acetals Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Fatty acyl glycosides of mono- and disaccharides Hydrocarbon derivatives Monoalkyl phosphates Monocarboxylic acids and derivatives Monosaccharide phosphates O-glycosyl compounds Organic oxides Oxacyclic compounds Oxanes Polyols Primary alcohols Secondary alcohols Sugar acids and derivatives Acetal Alcohol Aliphatic heteromonocyclic compound Alkyl phosphate Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acyl Fatty acyl glycoside Fatty acyl glycoside of mono- or disaccharide Glyceric_acid Glycosyl compound Hexose phosphate Hydrocarbon derivative Hydroxy acid Monoalkyl phosphate Monocarboxylic acid or derivatives Monosaccharide phosphate O-glycosyl compound Organic oxide Organic phosphoric acid derivative Organoheterocyclic compound Oxacycle Oxane Phosphoric acid ester Polyol Primary alcohol Secondary alcohol Sugar acid carbohydrate acid derivative monocarboxylic acid Solid logp -2.41 ALOGPS logs -1.09 ALOGPS solubility 2.84e+01 g/l ALOGPS logp -3.4 ChemAxon pka_strongest_acidic 1.22 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2R)-3-hydroxy-2-{[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-[(phosphonooxy)methyl]oxan-2-yl]oxy}propanoic acid ChemAxon average_mass 348.1978 ChemAxon mono_mass 348.04576252 ChemAxon smiles OC[C@@H](O[C@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@@H]1O)C(O)=O ChemAxon formula C9H17O12P ChemAxon inchi InChI=1S/C9H17O12P/c10-1-3(8(14)15)20-9-7(13)6(12)5(11)4(21-9)2-19-22(16,17)18/h3-7,9-13H,1-2H2,(H,14,15)(H2,16,17,18)/t3-,4-,5-,6+,7+,9+/m1/s1 ChemAxon inchikey BOLXAGHGKNGVBE-MTXRGOKVSA-N ChemAxon polar_surface_area 203.44 ChemAxon refractivity 63.67 ChemAxon polarizability 28.12 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 11 ChemAxon donor_count 7 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 10664 Specdb::CMs 39836 Specdb::CMs 149188 Specdb::CMs 149190 Specdb::CMs 149192 Specdb::CMs 154911 Specdb::CMs 279713 Specdb::MsMs 26288 Specdb::MsMs 26289 Specdb::MsMs 26290 Specdb::MsMs 32846 Specdb::MsMs 32847 Specdb::MsMs 32848 Specdb::MsMs 2313710 Specdb::MsMs 2313711 Specdb::MsMs 2313712 Specdb::MsMs 2652449 Specdb::MsMs 2652450 Specdb::MsMs 2652451 Specdb::NmrOneD 11462 Specdb::NmrOneD 11463 Specdb::NmrOneD 11464 Specdb::NmrOneD 11465 Specdb::NmrOneD 11466 Specdb::NmrOneD 11467 Specdb::NmrOneD 11468 Specdb::NmrOneD 11469 Specdb::NmrOneD 11470 Specdb::NmrOneD 11471 Specdb::NmrOneD 11472 Specdb::NmrOneD 11473 Specdb::NmrOneD 11474 Specdb::NmrOneD 11475 Specdb::NmrOneD 11476 Specdb::NmrOneD 11477 Specdb::NmrOneD 11478 Specdb::NmrOneD 11479 Specdb::NmrOneD 11480 Specdb::NmrOneD 11481 HMDB12152 #<Reference:0x000055ce31948720> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823