1.0 2011-09-21 01:46:24 UTC 2015-07-21 06:59:33 UTC FDB028863 Dopamine quinone Dopamine-quinone is synthesized by oxidation of the catechol ring of dopamine. If this occurs within the neuronal cytosol, the quinone may react with cytosolic components, particularly with cysteine residues. (PMID: 12835101) Dopamine quinone is produce by the reaction between dopamine and oxygen, with water as the byproduct. The reaction is catalyzed by the tyrosinase precursor. [HMDB] 4-(2-aminoethyl)-1,2-benzoquinone 4-(2-Aminoethyl)-3,5-cyclohexadiene-1,2-dione 4-(2-aminoethyl)-O-benzoquinone dopamine o-quinone Dopaminoquinone DoQ C8H9NO2 151.1626 151.063328537 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-dione 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-dione 50673-96-6 NCCC1=CC(=O)C(=O)C=C1 InChI=1S/C8H9NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5H,3-4,9H2 PQPXZWUZIOASKS-UHFFFAOYSA-N belongs to the class of organic compounds known as o-benzoquinones. These are benzoquinones where the two C=O groups are attached at the 1- and 2-positions, respectively. O-benzoquinones Organic compounds Organic oxygen compounds Organooxygen compounds Carbonyl compounds Aliphatic homomonocyclic compounds Hydrocarbon derivatives Monoalkylamines Organic oxides Organopnictogen compounds Aliphatic homomonocyclic compound Amine Hydrocarbon derivative O-benzoquinone Organic nitrogen compound Organic oxide Organonitrogen compound Organopnictogen compound Primary aliphatic amine Primary amine benzoquinones primary amino compound Solid logp -0.29 ALOGPS logs -1.35 ALOGPS solubility 6.80e+00 g/l ALOGPS logp 0.47 ChemAxon pka_strongest_basic 9.76 ChemAxon iupac 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-dione ChemAxon average_mass 151.1626 ChemAxon mono_mass 151.063328537 ChemAxon smiles NCCC1=CC(=O)C(=O)C=C1 ChemAxon formula C8H9NO2 ChemAxon inchi InChI=1S/C8H9NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5H,3-4,9H2 ChemAxon inchikey PQPXZWUZIOASKS-UHFFFAOYSA-N ChemAxon polar_surface_area 60.16 ChemAxon refractivity 43.65 ChemAxon polarizability 15.25 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22509 Specdb::CMs 148917 Specdb::MsIr 2709 Specdb::MsIr 2710 Specdb::MsMs 56673 Specdb::MsMs 56674 Specdb::MsMs 56675 Specdb::MsMs 112164 Specdb::MsMs 112165 Specdb::MsMs 112166 Specdb::MsMs 3045415 Specdb::MsMs 3045416 Specdb::MsMs 3045417 Specdb::MsMs 3095137 Specdb::MsMs 3095138 Specdb::MsMs 3095139 Specdb::NmrOneD 11582 Specdb::NmrOneD 11583 Specdb::NmrOneD 11584 Specdb::NmrOneD 11585 Specdb::NmrOneD 11586 Specdb::NmrOneD 11587 Specdb::NmrOneD 11588 Specdb::NmrOneD 11589 Specdb::NmrOneD 11590 Specdb::NmrOneD 11591 Specdb::NmrOneD 11592 Specdb::NmrOneD 11593 Specdb::NmrOneD 11594 Specdb::NmrOneD 11595 Specdb::NmrOneD 11596 Specdb::NmrOneD 11597 Specdb::NmrOneD 11598 Specdb::NmrOneD 11599 Specdb::NmrOneD 11600 Specdb::NmrOneD 11601 HMDB12219 #<Reference:0x000055ce3238a120> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823