1.0 2011-09-21 01:47:18 UTC 2015-07-21 06:59:34 UTC FDB028919 Tetrahydropteroyltri-L-glutamate A human metabolite taken as a putative food compound of mammalian origin [HMDB] (6S)-H4PteGlu3 C29H37N9O12 703.6572 703.256167693 (2S)-2-[(4S)-4-[(4S)-4-{[4-({[(6S)-2-amino-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]formamido}-4-carboxybutanamido]-4-carboxybutanamido]pentanedioic acid (2S)-2-[(4S)-4-[(4S)-4-{[4-({[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-1H-pteridin-6-yl]methyl}amino)phenyl]formamido}-4-carboxybutanamido]-4-carboxybutanamido]pentanedioic acid NC1=NC(=O)C2=C(NC[C@H](CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(O)=O)C(O)=O)C(O)=O)C(O)=O)N2)N1 InChI=1S/C29H37N9O12/c30-29-37-23-22(25(44)38-29)33-15(12-32-23)11-31-14-3-1-13(2-4-14)24(43)36-18(28(49)50)6-9-20(40)34-16(26(45)46)5-8-19(39)35-17(27(47)48)7-10-21(41)42/h1-4,15-18,31,33H,5-12H2,(H,34,40)(H,35,39)(H,36,43)(H,41,42)(H,45,46)(H,47,48)(H,49,50)(H4,30,32,37,38,44)/t15-,16-,17-,18-/m0/s1 RXWVHRYZTWZATH-XSLAGTTESA-N belongs to the class of organic compounds known as tetrahydrofolic acids and derivatives. These are heterocyclic compounds based on the 5,6,7,8-tetrahydropteroic acid skeleton conjugated with at least one L-glutamic acid unit (or a derivative thereof) . Tetrahydrofolic acids and derivatives Organic compounds Organoheterocyclic compounds Pteridines and derivatives Pterins and derivatives Aromatic heteropolycyclic compounds Amino acids Aminobenzamides Aminopyrimidines and derivatives Aniline and substituted anilines Azacyclic compounds Benzoyl derivatives Carbonyl compounds Carboxylic acids Gamma-glutamyl amino acids Glutamic acid and derivatives Glutamine and derivatives Heteroaromatic compounds Hippuric acids Hydrocarbon derivatives N-acyl amines N-acyl-L-alpha-amino acids Oligopeptides Organic oxides Organopnictogen compounds Phenylalkylamines Primary amines Pyrimidones Secondary alkylarylamines Secondary carboxylic acid amides Tetracarboxylic acids and derivatives Vinylogous amides Alpha-amino acid or derivatives Alpha-oligopeptide Amine Amino acid Amino acid or derivatives Aminobenzamide Aminobenzoic acid or derivatives Aminopyrimidine Aniline or substituted anilines Aromatic heteropolycyclic compound Azacycle Benzamide Benzenoid Benzoic acid or derivatives Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Fatty acyl Fatty amide Gamma-glutamyl alpha-amino acid Glutamic acid or derivatives Glutamine or derivatives Heteroaromatic compound Hippuric acid Hippuric acid or derivatives Hydrocarbon derivative Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine N-acyl-l-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalkylamine Primary amine Pyrimidine Pyrimidone Secondary aliphatic/aromatic amine Secondary amine Secondary carboxylic acid amide Tetracarboxylic acid or derivatives Tetrahydrofolic acid or derivatives Vinylogous amide tetrahydropteroyltri-L-glutamate Solid logp -1.64 ALOGPS logs -3.29 ALOGPS solubility 3.59e-01 g/l ALOGPS logp -4.3 ChemAxon pka_strongest_acidic 2.59 ChemAxon pka_strongest_basic 3.12 ChemAxon iupac (2S)-2-[(4S)-4-[(4S)-4-{[4-({[(6S)-2-amino-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]formamido}-4-carboxybutanamido]-4-carboxybutanamido]pentanedioic acid ChemAxon average_mass 703.6572 ChemAxon mono_mass 703.256167693 ChemAxon smiles NC1=NC(=O)C2=C(NC[C@H](CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(O)=O)C(O)=O)C(O)=O)C(O)=O)N2)N1 ChemAxon formula C29H37N9O12 ChemAxon inchi InChI=1S/C29H37N9O12/c30-29-37-23-22(25(44)38-29)33-15(12-32-23)11-31-14-3-1-13(2-4-14)24(43)36-18(28(49)50)6-9-20(40)34-16(26(45)46)5-8-19(39)35-17(27(47)48)7-10-21(41)42/h1-4,15-18,31,33H,5-12H2,(H,34,40)(H,35,39)(H,36,43)(H,41,42)(H,45,46)(H,47,48)(H,49,50)(H4,30,32,37,38,44)/t15-,16-,17-,18-/m0/s1 ChemAxon inchikey RXWVHRYZTWZATH-XSLAGTTESA-N ChemAxon polar_surface_area 340.07 ChemAxon refractivity 177.56 ChemAxon polarizability 69.1 ChemAxon rotatable_bond_count 19 ChemAxon acceptor_count 18 ChemAxon donor_count 12 ChemAxon physiological_charge -4 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 38606 Specdb::MsMs 38607 Specdb::MsMs 38608 Specdb::MsMs 41054 Specdb::MsMs 41055 Specdb::MsMs 41056 Specdb::MsMs 2791913 Specdb::MsMs 2791914 Specdb::MsMs 2791915 Specdb::MsMs 2916908 Specdb::MsMs 2916909 Specdb::MsMs 2916910 Specdb::NmrOneD 97058 Specdb::NmrOneD 97059 Specdb::NmrOneD 97060 Specdb::NmrOneD 97061 Specdb::NmrOneD 97062 Specdb::NmrOneD 97063 Specdb::NmrOneD 97064 Specdb::NmrOneD 97065 Specdb::NmrOneD 97066 Specdb::NmrOneD 97067 Specdb::NmrOneD 97068 Specdb::NmrOneD 97069 Specdb::NmrOneD 97070 Specdb::NmrOneD 97071 Specdb::NmrOneD 97072 Specdb::NmrOneD 97073 Specdb::NmrOneD 97074 Specdb::NmrOneD 97075 Specdb::NmrOneD 97076 Specdb::NmrOneD 97077 Specdb::CMs 59522 Specdb::CMs 749755 Specdb::CMs 749756 Specdb::CMs 749757 Specdb::CMs 749758 Specdb::CMs 749759 Specdb::CMs 749760 Specdb::CMs 749761 Specdb::CMs 749762 Specdb::CMs 749763 Specdb::CMs 749764 Specdb::CMs 749765 Specdb::CMs 749766 Specdb::CMs 749767 Specdb::CMs 749768 Specdb::CMs 749769 Specdb::CMs 749770 Specdb::CMs 749771 Specdb::CMs 749772 Specdb::CMs 749773 Specdb::CMs 749774 Specdb::CMs 749775 Specdb::CMs 749776 Specdb::CMs 749777 Specdb::CMs 749778 HMDB12290 17420 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823