1.0 2011-09-21 01:47:34 UTC 2015-07-21 06:59:34 UTC FDB028932 2-Methyl-1-hydroxybutyl-ThPP 2-Methyl-1-hydroxybutyl-ThPP is an intermediate in Valine, leucine and isoleucine degradation. 2-Methyl-1-hydroxybutyl-ThPP is the second to last step for the synthesis of (S)-2-Methylbutanoyl-CoA. 2-Methyl-1-hydroxybutyl-ThPP is converted from (S)-3-Methyl-2-oxopentanoic acid via the enzyme 2-oxoisovalerate dehydrogenase E1 component, alpha subunit(EC 1.2.4.4). It is then converted to S-(2-Methylbutanoyl)-dihydrolipoamide-E via the same enzyme. [HMDB] 2-Methyl-1-hydroxybutyl-TPP C17H29N4O8P2S 511.447 511.118132638 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-2-[(2S)-1-hydroxy-2-methylbutyl]-4-methyl-1,3-thiazol-3-ium 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-2-[(2S)-1-hydroxy-2-methylbutyl]-4-methyl-1,3-thiazol-3-ium CC[C@H](C)C(O)C1=[N+](CC2=CN=C(C)N=C2N)C(C)=C(CCOP(O)(=O)OP(O)(O)=O)S1 InChI=1S/C17H28N4O8P2S/c1-5-10(2)15(22)17-21(9-13-8-19-12(4)20-16(13)18)11(3)14(32-17)6-7-28-31(26,27)29-30(23,24)25/h8,10,15,22H,5-7,9H2,1-4H3,(H4-,18,19,20,23,24,25,26,27)/p+1/t10-,15?/m0/s1 CUBSXOWPMAOFDG-MYHCZTBNSA-O belongs to the class of organic compounds known as thiamine phosphates. These are thiamine derivatives in which the hydroxyl group of the ethanol moiety is substituted by a phosphate group. Thiamine phosphates Organic compounds Organoheterocyclic compounds Diazines Pyrimidines and pyrimidine derivatives Aromatic heteromonocyclic compounds 2,4,5-trisubstituted thiazoles Aminopyrimidines and derivatives Aromatic alcohols Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Imidolactams Monoalkyl phosphates Organic cations Organic oxides Organic pyrophosphates Organopnictogen compounds Primary amines Secondary alcohols 2,4,5-trisubstituted 1,3-thiazole Alcohol Alkyl phosphate Amine Aminopyrimidine Aromatic alcohol Aromatic heteromonocyclic compound Azacycle Azole Heteroaromatic compound Hydrocarbon derivative Imidolactam Monoalkyl phosphate Organic cation Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organic pyrophosphate Organonitrogen compound Organooxygen compound Organopnictogen compound Phosphoric acid ester Primary amine Secondary alcohol Thiamine-phosphate Thiazole thiamine phosphate Solid logp -0.18 ALOGPS logs -3.87 ALOGPS solubility 7.42e-02 g/l ALOGPS logp -5.6 ChemAxon pka_strongest_acidic 1.78 ChemAxon pka_strongest_basic 5.53 ChemAxon iupac 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-2-[(2S)-1-hydroxy-2-methylbutyl]-4-methyl-1,3-thiazol-3-ium ChemAxon average_mass 511.447 ChemAxon mono_mass 511.118132638 ChemAxon smiles CC[C@H](C)C(O)C1=[N+](CC2=CN=C(C)N=C2N)C(C)=C(CCOP(O)(=O)OP(O)(O)=O)S1 ChemAxon formula C17H29N4O8P2S ChemAxon inchi InChI=1S/C17H28N4O8P2S/c1-5-10(2)15(22)17-21(9-13-8-19-12(4)20-16(13)18)11(3)14(32-17)6-7-28-31(26,27)29-30(23,24)25/h8,10,15,22H,5-7,9H2,1-4H3,(H4-,18,19,20,23,24,25,26,27)/p+1/t10-,15?/m0/s1 ChemAxon inchikey CUBSXOWPMAOFDG-MYHCZTBNSA-O ChemAxon polar_surface_area 189.2 ChemAxon refractivity 130.18 ChemAxon polarizability 48.11 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 9 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 1 ChemAxon Specdb::CMs 13925 Specdb::CMs 39912 Specdb::NmrOneD 97278 Specdb::NmrOneD 97279 Specdb::NmrOneD 97280 Specdb::NmrOneD 97281 Specdb::NmrOneD 97282 Specdb::NmrOneD 97283 Specdb::NmrOneD 97284 Specdb::NmrOneD 97285 Specdb::NmrOneD 97286 Specdb::NmrOneD 97287 Specdb::NmrOneD 97288 Specdb::NmrOneD 97289 Specdb::NmrOneD 97290 Specdb::NmrOneD 97291 Specdb::NmrOneD 97292 Specdb::NmrOneD 97293 Specdb::NmrOneD 97294 Specdb::NmrOneD 97295 Specdb::NmrOneD 97296 Specdb::NmrOneD 97297 Specdb::MsMs 296728 Specdb::MsMs 296729 Specdb::MsMs 296730 Specdb::MsMs 2410630 Specdb::MsMs 2410631 Specdb::MsMs 2410632 HMDB12310 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial P21953 BCKDHB