1.0 2011-09-21 01:52:29 UTC 2025-11-19 02:57:07 UTC FDB029242 Monodehydro-L-ascorbic acid A human metabolite taken as a putative food compound of mammalian origin [HMDB] Ascorbate radical Monodehydroascorbate Semidehydroascorbic acid C6H7O6 175.1162 175.024262956 (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2,5-dihydrofuran-3-olate vitamin-C 6730-29-6 [H][C@@]1(OC(=O)C(O)=C1[O-])[C@@H](O)CO InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/p-1/t2-,5+/m0/s1 CIWBSHSKHKDKBQ-JLAZNSOCSA-M belongs to the class of organic compounds known as butenolides. These are dihydrofurans with a carbonyl group at the C2 carbon atom. Butenolides Organic compounds Organoheterocyclic compounds Dihydrofurans Furanones Aliphatic heteromonocyclic compounds 1,2-diols Carbonyl compounds Enoate esters Hydrocarbon derivatives Lactones Monocarboxylic acids and derivatives Organic anions Organic oxides Oxacyclic compounds Primary alcohols Secondary alcohols Vinylogous acids 1,2-diol 2-furanone Alcohol Aliphatic heteromonocyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Enoate ester Hydrocarbon derivative Lactone Monocarboxylic acid or derivatives Organic anion Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Primary alcohol Secondary alcohol Vinylogous acid ascorbate logp -1.50 ALOGPS logs 0.53 ALOGPS solubility 6.51e+02 g/l ALOGPS logp -1.9 ChemAxon pka_strongest_acidic 4.36 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2,5-dihydrofuran-3-olate ChemAxon average_mass 175.1162 ChemAxon mono_mass 175.024262956 ChemAxon smiles [H][C@@]1(OC(=O)C(O)=C1[O-])[C@@H](O)CO ChemAxon formula C6H7O6 ChemAxon inchi InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/p-1/t2-,5+/m0/s1 ChemAxon inchikey CIWBSHSKHKDKBQ-JLAZNSOCSA-M ChemAxon polar_surface_area 110.05 ChemAxon refractivity 47.58 ChemAxon polarizability 14.52 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge -1 ChemAxon HMDB13004 16504