1.0 2011-09-21 01:54:45 UTC 2015-07-21 06:59:42 UTC FDB029369 Phenylalanylphenylalanine Phenylalanylphenylalanine (Phe-Phe) is a peptide made of two phenylalanine molecules. Phenylalanine is an essential amino acid and the precursor for the amino acid tyrosine. Like tyrosine, it is the precursor of catecholamines in the body (tyramine, dopamine, epinephrine and norepinephrine). The psychotropic drugs (mescaline, morphine, codeine, and papaverine) also have phenylalanine as a constituent. Phenylalanine is a precursor of the neurotransmitters called catecholamines, which are adrenalin-like substances. Phenylalanine is highly concentrated in the human brain and plasma. The Phe-Phe recognition motif of the Alzheimer?s Abeta peptide is the smallest peptide able to assemble into higher ?order structures.(PMC:1796831) [HMDB] 3-Phenyl-N-(3-phenyl-L-alanyl)-L-alanine Di-L-phenylalanine L-Phenylalanyl-L-phenylalanine Phe-phe Phenylalanyl-phenylalanine C18H20N2O3 312.363 312.147392516 2-(2-amino-3-phenylpropanamido)-3-phenylpropanoic acid phe-phe 2577-40-4 NC(CC1=CC=CC=C1)C(=O)NC(CC1=CC=CC=C1)C(O)=O InChI=1S/C18H20N2O3/c19-15(11-13-7-3-1-4-8-13)17(21)20-16(18(22)23)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12,19H2,(H,20,21)(H,22,23) GKZIWHRNKRBEOH-UHFFFAOYSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Alpha amino acid amides Amino acids Amphetamines and derivatives Aralkylamines Carbonyl compounds Carboxylic acids Fatty amides Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Phenylalanine and derivatives Phenylpropanoic acids Secondary carboxylic acid amides 3-phenylpropanoic-acid Alpha-amino acid amide Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Amphetamine or derivatives Aralkylamine Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid Fatty acyl Fatty amide Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalanine or derivatives Primary aliphatic amine Primary amine Secondary carboxylic acid amide Solid logp -0.27 ALOGPS logs -3.86 ALOGPS solubility 4.30e-02 g/l ALOGPS logp -0.067 ChemAxon pka_strongest_acidic 3.78 ChemAxon pka_strongest_basic 8.01 ChemAxon iupac 2-(2-amino-3-phenylpropanamido)-3-phenylpropanoic acid ChemAxon average_mass 312.363 ChemAxon mono_mass 312.147392516 ChemAxon smiles NC(CC1=CC=CC=C1)C(=O)NC(CC1=CC=CC=C1)C(O)=O ChemAxon formula C18H20N2O3 ChemAxon inchi InChI=1S/C18H20N2O3/c19-15(11-13-7-3-1-4-8-13)17(21)20-16(18(22)23)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12,19H2,(H,20,21)(H,22,23) ChemAxon inchikey GKZIWHRNKRBEOH-UHFFFAOYSA-N ChemAxon polar_surface_area 92.42 ChemAxon refractivity 87.03 ChemAxon polarizability 33.55 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 21209 Specdb::CMs 40108 Specdb::MsMs 67593 Specdb::MsMs 67594 Specdb::MsMs 67595 Specdb::MsMs 125448 Specdb::MsMs 125449 Specdb::MsMs 125450 HMDB13302 #<Reference:0x000055ce31ee41c0>