1.0 2011-09-26 22:53:11 UTC 2025-11-19 02:58:04 UTC FDB029633 (3E,5E)-1,3,5-octatriene Flavouring compound [Flavornet] C8H12 108.184 108.093900386 (3E,5E)-octa-1,3,5-triene (3E,5E)-octa-1,3,5-triene 33580-05-1 [H]\C(CC)=C(\[H])/C(/[H])=C(\[H])C=C InChI=1S/C8H12/c1-3-5-7-8-6-4-2/h3,5-8H,1,4H2,2H3/b7-5+,8-6+ HOXGZVUCAYFWGR-KQQUZDAGSA-N belongs to the class of organic compounds known as alkatrienes. These are acyclic hydrocarbons that contain exactly three carbon-to-carbon double bonds. Alkatrienes Organic compounds Hydrocarbons Unsaturated hydrocarbons Olefins Aliphatic acyclic compounds Unsaturated aliphatic hydrocarbons Aliphatic acyclic compound Alkatriene Unsaturated aliphatic hydrocarbon logp 3.81 ALOGPS logs -3.42 ALOGPS solubility 4.10e-02 g/l ALOGPS logp 2.99 ChemAxon iupac (3E,5E)-octa-1,3,5-triene ChemAxon average_mass 108.184 ChemAxon mono_mass 108.093900386 ChemAxon smiles [H]\C(CC)=C(\[H])/C(/[H])=C(\[H])C=C ChemAxon formula C8H12 ChemAxon inchi InChI=1S/C8H12/c1-3-5-7-8-6-4-2/h3,5-8H,1,4H2,2H3/b7-5+,8-6+ ChemAxon inchikey HOXGZVUCAYFWGR-KQQUZDAGSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 40.89 ChemAxon polarizability 14.36 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1296157 Specdb::MsMs 1296158 Specdb::MsMs 1296159 Specdb::MsMs 1410805 Specdb::MsMs 1410806 Specdb::MsMs 1410807 Specdb::MsMs 3606994 Specdb::MsMs 3606995 Specdb::MsMs 3606996 Specdb::MsMs 3606997 Specdb::MsMs 3606998 Specdb::MsMs 3606999 green plastic