1.0 2011-09-26 22:53:37 UTC 2025-11-19 02:58:15 UTC FDB029652 1,5-octadien-3-ol Flavouring compound [Flavornet] C8H14O 126.199 126.104465071 octa-1,5-dien-3-ol octa-1,5-dien-3-ol 83861-74-9 CCC=CCC(O)C=C InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h4-6,8-9H,2-3,7H2,1H3 APFBWMGEGSELQP-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty alcohols. These are aliphatic alcohols consisting of a chain of a least six carbon atoms. Fatty alcohols Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty alcohols Aliphatic acyclic compounds Hydrocarbon derivatives Secondary alcohols Alcohol Aliphatic acyclic compound Fatty alcohol Hydrocarbon derivative Organic oxygen compound Organooxygen compound Secondary alcohol logp 2.39 ALOGPS logs -1.91 ALOGPS solubility 1.54e+00 g/l ALOGPS logp 2.12 ChemAxon pka_strongest_acidic 17.44 ChemAxon pka_strongest_basic -1.7 ChemAxon iupac octa-1,5-dien-3-ol ChemAxon average_mass 126.199 ChemAxon mono_mass 126.104465071 ChemAxon smiles CCC=CCC(O)C=C ChemAxon formula C8H14O ChemAxon inchi InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h4-6,8-9H,2-3,7H2,1H3 ChemAxon inchikey APFBWMGEGSELQP-UHFFFAOYSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 41.29 ChemAxon polarizability 15.42 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1269430 Specdb::MsMs 1269431 Specdb::MsMs 1269432 Specdb::MsMs 1384453 Specdb::MsMs 1384454 Specdb::MsMs 1384455 Specdb::MsMs 3607051 Specdb::MsMs 3607052 Specdb::MsMs 3607053 Specdb::MsMs 3607054 Specdb::MsMs 3607055 Specdb::MsMs 3607056 Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 earth earthy herb herbal