1.0 2011-09-26 22:53:46 UTC 2025-11-19 02:58:17 UTC FDB029659 2-acetyl-1,4,5,6-tetrahydropyridine Flavouring compound [Flavornet] C7H11NO 125.171 125.084063978 1-(1,4,5,6-tetrahydropyridin-2-yl)ethan-1-one 2-acetyltetrahydropyridine 25343-57-1 CC(=O)C1=CCCCN1 InChI=1S/C7H11NO/c1-6(9)7-4-2-3-5-8-7/h4,8H,2-3,5H2,1H3 HRAOWRVFLSYJKN-UHFFFAOYSA-N belongs to the class of organic compounds known as tetrahydropyridines. These are derivatives of pyridine in which two double bonds in the pyridine moiety are reduced by adding four hydrogen atoms. Tetrahydropyridines Organic compounds Organoheterocyclic compounds Pyridines and derivatives Hydropyridines Aliphatic heteromonocyclic compounds Alpha-amino ketones Azacyclic compounds Dialkylamines Enamines Hydrocarbon derivatives Organic oxides Organopnictogen compounds Aliphatic heteromonocyclic compound Alpha-aminoketone Amine Azacycle Carbonyl group Enamine Hydrocarbon derivative Ketone Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary aliphatic amine Secondary amine Tetrahydropyridine tetrahydropyridine logp 0.79 ALOGPS logs -0.34 ALOGPS solubility 5.77e+01 g/l ALOGPS logp 0.5 ChemAxon pka_strongest_basic 4.1 ChemAxon iupac 1-(1,4,5,6-tetrahydropyridin-2-yl)ethan-1-one ChemAxon average_mass 125.171 ChemAxon mono_mass 125.084063978 ChemAxon smiles CC(=O)C1=CCCCN1 ChemAxon formula C7H11NO ChemAxon inchi InChI=1S/C7H11NO/c1-6(9)7-4-2-3-5-8-7/h4,8H,2-3,5H2,1H3 ChemAxon inchikey HRAOWRVFLSYJKN-UHFFFAOYSA-N ChemAxon polar_surface_area 29.1 ChemAxon refractivity 37.78 ChemAxon polarizability 13.89 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1332691 Specdb::MsMs 1332692 Specdb::MsMs 1332693 Specdb::MsMs 1446940 Specdb::MsMs 1446941 Specdb::MsMs 1446942 Specdb::MsMs 3607075 Specdb::MsMs 3607076 Specdb::MsMs 3607077 Specdb::MsMs 3608296 Specdb::MsMs 3608297 Specdb::MsMs 3608298 Tortilla chip Type 2 specific caramel caramellic