1.0 2011-09-26 22:54:11 UTC 2015-07-21 07:00:14 UTC FDB029678 tetrahydro-4-methyl-2-(2-methyl-1-propenyl)-2,5-cis-2H-pyran Flavouring compound [Flavornet] C10H18O 154.2493 154.135765198 4-methyl-2-(2-methylprop-1-en-1-yl)oxane rose oxide 3033-23-6 CC1CCOC(C1)C=C(C)C InChI=1S/C10H18O/c1-8(2)6-10-7-9(3)4-5-11-10/h6,9-10H,4-5,7H2,1-3H3 CZCBTSFUTPZVKJ-UHFFFAOYSA-N belongs to the class of organic compounds known as oxanes. Oxanes are compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms. Oxanes Organic compounds Organoheterocyclic compounds Oxanes Aliphatic heteromonocyclic compounds Dialkyl ethers Hydrocarbon derivatives Oxacyclic compounds Aliphatic heteromonocyclic compound Dialkyl ether Ether Hydrocarbon derivative Organic oxygen compound Organooxygen compound Oxacycle Oxane logp 3.30 ALOGPS logs -2.62 ALOGPS solubility 3.74e-01 g/l ALOGPS logp 2.68 ChemAxon pka_strongest_basic -4.2 ChemAxon iupac 4-methyl-2-(2-methylprop-1-en-1-yl)oxane ChemAxon average_mass 154.2493 ChemAxon mono_mass 154.135765198 ChemAxon smiles CC1CCOC(C1)C=C(C)C ChemAxon formula C10H18O ChemAxon inchi InChI=1S/C10H18O/c1-8(2)6-10-7-9(3)4-5-11-10/h6,9-10H,4-5,7H2,1-3H3 ChemAxon inchikey CZCBTSFUTPZVKJ-UHFFFAOYSA-N ChemAxon polar_surface_area 9.23 ChemAxon refractivity 48.49 ChemAxon polarizability 19.33 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 15164 Specdb::CMs 166392 Specdb::MsMs 6686 Specdb::MsMs 6687 Specdb::MsMs 6688 Specdb::MsMs 8840 Specdb::MsMs 8841 Specdb::MsMs 8842 Specdb::MsMs 13358 Specdb::MsMs 13359 Specdb::MsMs 13360 Specdb::MsMs 15512 Specdb::MsMs 15513 Specdb::MsMs 15514 Specdb::MsMs 2429317 Specdb::MsMs 2429318 Specdb::MsMs 2429319 Specdb::MsMs 2505554 Specdb::MsMs 2505555 Specdb::MsMs 2505556 cortex floral geranium green metallic powdery rose sweet