1.0 2011-09-26 22:54:16 UTC 2025-11-19 02:58:27 UTC FDB029682 (2R,4R)-tetrahydro-4-methyl-2-(2-methyl-1-propenyl)-2H-pyran Flavouring compound [Flavornet] C10H18O 154.2493 154.135765198 (2R,4R)-4-methyl-2-(2-methylprop-1-en-1-yl)oxane (2R,4R)-4-methyl-2-(2-methylprop-1-en-1-yl)oxane 5258-11-7 CC1CCOC(C1)C=C(C)C InChI=1S/C10H18O/c1-8(2)6-10-7-9(3)4-5-11-10/h6,9-10H,4-5,7H2,1-3H3 CZCBTSFUTPZVKJ-UHFFFAOYSA-N belongs to the class of organic compounds known as oxanes. Oxanes are compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms. Oxanes Organic compounds Organoheterocyclic compounds Oxanes Aliphatic heteromonocyclic compounds Dialkyl ethers Hydrocarbon derivatives Oxacyclic compounds Aliphatic heteromonocyclic compound Dialkyl ether Ether Hydrocarbon derivative Organic oxygen compound Organooxygen compound Oxacycle Oxane logp 2.68 ChemAxon pka_strongest_basic -4.2 ChemAxon iupac (2R,4R)-4-methyl-2-(2-methylprop-1-en-1-yl)oxane ChemAxon average_mass 154.2493 ChemAxon mono_mass 154.135765198 ChemAxon smiles CC1CCOC(C1)C=C(C)C ChemAxon formula C10H18O ChemAxon inchi InChI=1S/C10H18O/c1-8(2)6-10-7-9(3)4-5-11-10/h6,9-10H,4-5,7H2,1-3H3 ChemAxon inchikey CZCBTSFUTPZVKJ-UHFFFAOYSA-N ChemAxon polar_surface_area 9.23 ChemAxon refractivity 48.49 ChemAxon polarizability 18.99 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 3251 Specdb::MsMs 179781 Specdb::MsMs 179782 Specdb::MsMs 179783 Specdb::MsMs 182115 Specdb::MsMs 182116 Specdb::MsMs 182117 Grape Type 1 specific Vitis 3603 Grape wine Type 2 specific flower