1.0 2011-09-26 22:55:31 UTC 2025-11-19 02:58:47 UTC FDB029737 5-methoxy-6-(2-propenyl)-1,3-benzodioxole Flavouring compound [Flavornet] C11H12O3 192.214 192.078644246 5-methoxy-6-(prop-2-en-1-yl)-2H-1,3-benzodioxole sarisan 18607-93-7 COC1=CC2=C(OCO2)C=C1CC=C InChI=1S/C11H12O3/c1-3-4-8-5-10-11(14-7-13-10)6-9(8)12-2/h3,5-6H,1,4,7H2,2H3 FYRHTIWFKXZWAD-UHFFFAOYSA-N belongs to the class of organic compounds known as benzodioxoles. These are organic compounds containing a benzene ring fused to either isomers of dioxole. Dioxole is a five-membered unsaturated ring of two oxygen atoms and three carbon atoms. Benzodioxoles Organic compounds Organoheterocyclic compounds Benzodioxoles Aromatic heteropolycyclic compounds Acetals Alkyl aryl ethers Anisoles Hydrocarbon derivatives Oxacyclic compounds Acetal Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Benzodioxole Ether Hydrocarbon derivative Organic oxygen compound Organooxygen compound Oxacycle benzodioxoles logp 2.46 ALOGPS logs -2.33 ALOGPS solubility 8.94e-01 g/l ALOGPS logp 2.54 ChemAxon pka_strongest_basic -4.5 ChemAxon iupac 5-methoxy-6-(prop-2-en-1-yl)-2H-1,3-benzodioxole ChemAxon average_mass 192.214 ChemAxon mono_mass 192.078644246 ChemAxon smiles COC1=CC2=C(OCO2)C=C1CC=C ChemAxon formula C11H12O3 ChemAxon inchi InChI=1S/C11H12O3/c1-3-4-8-5-10-11(14-7-13-10)6-9(8)12-2/h3,5-6H,1,4,7H2,2H3 ChemAxon inchikey FYRHTIWFKXZWAD-UHFFFAOYSA-N ChemAxon polar_surface_area 27.69 ChemAxon refractivity 52.58 ChemAxon polarizability 20.19 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1333651 Specdb::MsMs 1333652 Specdb::MsMs 1333653 Specdb::MsMs 1447882 Specdb::MsMs 1447883 Specdb::MsMs 1447884 Specdb::MsMs 3607333 Specdb::MsMs 3607334 Specdb::MsMs 3607335 Specdb::MsMs 3607336 Specdb::MsMs 3607337 Specdb::MsMs 3607338 pepper spice