1.0 2011-12-09 21:08:12 UTC 2025-11-19 02:59:06 UTC FDB029792 Menatetrenone Inhibits bone resorption via PGE2 synthesis inhibition and other mechanisms. Antihaemorrhagic vitamin [CCD] Menatetrenone (MK4), is a menaquinone compound used as a hemostatic agent and as adjunctive therapy for the pain of osteoporosis. It is marketed for the latter indication in Japan by Eisai Co., under the trade name Glakay. Menatetrenone is one of the nine forms of vitamin K2. [Wikipedia]. Menatetrenone is found in many foods, some of which are painted comber, pizza, common bean, and cheese. 2-Methyl-3-(3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl)-1,4-naphthalenedione, 9CI Glakay Kaytwo Keivitan 2 Menaquinone-4 Menartu Menatetren MK4 Sawa K Tohmittel Two-VK C31H40O2 444.659 444.302830528 2-methyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]-1,4-dihydronaphthalene-1,4-dione menatetrenone 863-61-6 [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC1=C(C)C(=O)C2=CC=CC=C2C1=O)=C(\C)CCC=C(C)C InChI=1S/C31H40O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,12,14,16,18-20H,9-11,13,15,17,21H2,1-6H3/b23-14+,24-16+,25-20+ DKHGMERMDICWDU-GHDNBGIDSA-N belongs to the class of organic compounds known as menaquinones. These are vitamin K2 compounds consisting of a naphtho-1,4-quinone ring system, which is substituted at the 2-position by an isoprenyl side-chain, and usually, at the 3-position by a methyl group. Menaquinones Organic compounds Lipids and lipid-like molecules Prenol lipids Quinone and hydroquinone lipids Aromatic homopolycyclic compounds Aryl ketones Diterpenoids Hydrocarbon derivatives Naphthoquinones Organic oxides Quinones Aromatic homopolycyclic compound Aryl ketone Benzenoid Diterpenoid Hydrocarbon derivative Ketone Menaquinone Naphthalene Naphthoquinone Organic oxide Organic oxygen compound Organooxygen compound Quinone menaquinone logp 7.24 ALOGPS logs -5.96 ALOGPS solubility 4.89e-04 g/l ALOGPS logp 8.48 ChemAxon pka_strongest_basic -7.2 ChemAxon iupac 2-methyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]-1,4-dihydronaphthalene-1,4-dione ChemAxon average_mass 444.659 ChemAxon mono_mass 444.302830528 ChemAxon smiles [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC1=C(C)C(=O)C2=CC=CC=C2C1=O)=C(\C)CCC=C(C)C ChemAxon formula C31H40O2 ChemAxon inchi InChI=1S/C31H40O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,12,14,16,18-20H,9-11,13,15,17,21H2,1-6H3/b23-14+,24-16+,25-20+ ChemAxon inchikey DKHGMERMDICWDU-GHDNBGIDSA-N ChemAxon polar_surface_area 34.14 ChemAxon refractivity 145.51 ChemAxon polarizability 54.92 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 28235 Specdb::CMs 100487 Specdb::CMs 102734 Specdb::CMs 158000 Specdb::MsMs 103383 Specdb::MsMs 103384 Specdb::MsMs 103385 Specdb::MsMs 169413 Specdb::MsMs 169414 Specdb::MsMs 169415 Specdb::MsMs 2447163 Specdb::MsMs 2447164 Specdb::MsMs 2447165 Specdb::MsMs 2518497 Specdb::MsMs 2518498 Specdb::MsMs 2518499 Specdb::NmrOneD 286935 Specdb::NmrOneD 286936 Specdb::NmrOneD 286937 Specdb::NmrOneD 286938 Specdb::NmrOneD 286939 Specdb::NmrOneD 286940 Specdb::NmrOneD 286941 Specdb::NmrOneD 286942 Specdb::NmrOneD 286943 Specdb::NmrOneD 286944 Specdb::NmrOneD 286945 Specdb::NmrOneD 286946 Specdb::NmrOneD 286947 Specdb::NmrOneD 286948 Specdb::NmrOneD 286949 Specdb::NmrOneD 286950 Specdb::NmrOneD 286951 Specdb::NmrOneD 286952 Specdb::NmrOneD 286953 Specdb::NmrOneD 286954 Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Arepa Type 2 specific 0.001 0.001 0.001 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.05 0.05 0.05 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 0.002452 0.0187 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0007 0.0014 0.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beluga whale Type 1 specific Delphinapterus leucas 9749 0.002 0.002 0.002 mg/100 g Biscuit Type 2 specific 0.0 0.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.00005 0.0001 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Canola Type 2 specific 138011 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.002064 0.0076 0.0012 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.00065 0.0007 0.0006 mg/100 g Cheddar Cheese Type 2 Cheddar Cheese 2.7 2.7 2.7 mg/100 g Cheese Type 2 specific 0.07007 0.65 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0018 0.0018 0.0018 mg/100 g Chocolate Type 2 specific 0.000033 0.0001 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.001 0.001 0.001 mg/100 g Clam Type 1 0.1 0.1 0.1 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coconut oil Type 2 0.0 0.0 0.0 mg/100 g Cold cut Type 2 specific 0.00705 0.0115 0.0026 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.000075 0.0003 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.0 0.0 0.0 mg/100 g Corn chip Type 2 specific 0.0 0.0 0.0 mg/100 g Corn grits Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.001 0.001 0.001 mg/100 g Cracker Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 0.003265 0.0149 0.0 mg/100 g Dulce de leche Type 2 specific 0.0042 0.0042 0.0042 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.62785 2.5 0.0025 mg/100 g Egg roll Type 2 specific 0.0033 0.0033 0.0033 mg/100 g Eggs Unknown generic 0.0058 0.0114 0.0002 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 Empanada Type 2 specific 0.0026 0.0026 0.0026 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.150167 0.45 0.0002 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.001 0.002 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0006 0.0006 0.0006 mg/100 g Fruit-flavor drink Type 2 specific 0.0 0.0 0.0 mg/100 g Frybread Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.00002 0.0001 0.0 mg/100 g Horchata Type 2 specific 0.0 0.0 0.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.45 0.45 0.45 mg/100 g Macaroni and cheese Type 2 specific 0.00055 0.0011 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 0.000567 0.0017 0.0 mg/100 g Meatloaf Type 2 specific 0.001 0.001 0.001 mg/100 g Milk (Cow) Type 2 specific 0.001 0.001 0.001 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0002 0.0002 0.0002 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 Mozzarella cheese Type 2 2.0 2.0 2.0 mg/100 g Mule deer Type 1 specific Odocoileus 9871 Narrowleaf cattail Type 1 specific Typha angustifolia 59011 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 0.0 0.0 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 Other candy Type 2 specific 0.0001 0.0001 0.0001 mg/100 g Other dish Type 2 specific 0.002048 0.0072 0.0 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other sandwich Type 2 specific 0.0017 0.0018 0.0016 mg/100 g Other snack food Type 2 specific 0.0 0.0 0.0 mg/100 g Other soy product Type 2 specific 0.0 0.0 0.0 mg/100 g Other vegetable product Type 2 specific 0.0 0.0 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.2 0.2 0.2 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0002 0.0002 0.0002 mg/100 g Pan dulce Type 2 specific 0.0 0.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parmesan cheese Type 2 0.3 0.3 0.3 mg/100 g Pastry Type 2 specific 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Pie Type 2 specific 0.000367 0.0009 0.0 mg/100 g Pie crust Type 2 specific 0.002157 0.0045 0.0006 mg/100 g Piki bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.0005 0.0005 0.0005 mg/100 g Pizza Type 2 specific 0.002418 0.004 0.0011 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pot pie Type 2 specific 0.00415 0.0061 0.0022 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.00006 0.0002 0.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 0.003275 0.0061 0.0021 mg/100 g Pudding Type 2 specific 0.0008 0.0008 0.0008 mg/100 g Pupusa Type 2 specific 0.0022 0.0029 0.0008 mg/100 g Quail Type 1 specific Phasianidae 9005 Quinoa Type 1 specific Chenopodium quinoa 63459 0.82555 1.65 0.0011 mg/100 g Rabbit Type 1 specific Leporidae 9979 Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.00085 0.0015 0.0002 mg/100 g Ravioli Type 2 specific 0.00035 0.0004 0.0003 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 0.0 0.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 0.0 0.0 0.0 mg/100 g Sausage Type 2 specific 0.023543 0.0417 0.0088 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.0002 0.0004 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 0.0016 0.0016 0.0016 mg/100 g Snack bar Type 2 specific 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.043157 0.3 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 0.0002 0.0002 0.0002 mg/100 g Soup Type 2 specific 0.00155 0.0034 0.0 mg/100 g Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0021 0.0021 0.0021 mg/100 g Squab Type 1 specific Columba 8931 Stew Type 2 specific 0.0009 0.0009 0.0009 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Sweet custard Type 2 specific 0.0009 0.0009 0.0009 mg/100 g Swiss cheese Type 2 0.65 0.65 0.65 mg/100 g Tamale Type 2 specific 0.002167 0.0029 0.0009 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla chip Type 2 specific 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.45 0.45 0.45 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Wasabi Type 1 specific Wasabia japonica 75806 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.00055 0.0006 0.0005 mg/100 g Wild boar Type 1 specific Sus scrofa 9823