1.0 2019-10-15 19:48:36 UTC 2025-11-19 03:06:39 UTC FDB093591 2-Aminophenol C6H7NO 109.1259 109.052763851 2-aminophenol 2-aminophenol NC1=CC=CC=C1O InChI=1S/C6H7NO/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 CDAWCLOXVUBKRW-UHFFFAOYSA-N belongs to the class of organic compounds known as aniline and substituted anilines. These are organic compounds containing an aminobenzene moiety. Aniline and substituted anilines Organic compounds Benzenoids Benzene and substituted derivatives Aniline and substituted anilines Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Hydrocarbon derivatives Organooxygen compounds Organopnictogen compounds Primary amines o-Aminophenols 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Amine Aminophenol Aniline or substituted anilines Aromatic homomonocyclic compound Hydrocarbon derivative O-aminophenol Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Primary amine a phenol aminophenol logp 0.35 ALOGPS logs 0.02 ALOGPS solubility 1.16e+02 g/l ALOGPS logp 0.84 ChemAxon pka_strongest_acidic 10.35 ChemAxon pka_strongest_basic 4.52 ChemAxon iupac 2-aminophenol ChemAxon average_mass 109.1259 ChemAxon mono_mass 109.052763851 ChemAxon smiles NC1=CC=CC=C1O ChemAxon formula C6H7NO ChemAxon inchi InChI=1S/C6H7NO/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 ChemAxon inchikey CDAWCLOXVUBKRW-UHFFFAOYSA-N ChemAxon polar_surface_area 46.25 ChemAxon refractivity 32.74 ChemAxon polarizability 11.16 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 775 Specdb::CMs 1123 Specdb::CMs 1232 Specdb::CMs 29703 Specdb::CMs 31747 Specdb::CMs 31748 Specdb::NmrOneD 2721 Specdb::NmrOneD 3414 Specdb::MsMs 94542 Specdb::MsMs 94543 Specdb::MsMs 94544 Specdb::MsMs 158580 Specdb::MsMs 158581 Specdb::MsMs 158582 Specdb::MsMs 440154 Specdb::MsMs 445681 Specdb::MsMs 445682 Specdb::MsMs 445683 Specdb::MsMs 445684 Specdb::MsMs 445685 Specdb::MsMs 451983 Specdb::MsMs 452274 FOBI:030671