1.0 2019-10-15 19:55:26 UTC 2025-11-19 03:06:40 UTC FDB093610 3-Hydroxybenzaldehyde C7H6O2 122.123 122.036779433 3-hydroxybenzaldehyde 3-hydroxybenzaldehyde OC1=CC=CC(C=O)=C1 InChI=1S/C7H6O2/c8-5-6-2-1-3-7(9)4-6/h1-5,9H IAVREABSGIHHMO-UHFFFAOYSA-N belongs to the class of organic compounds known as hydroxybenzaldehydes. These are organic aromatic compounds containing a benzene ring carrying an aldehyde group and a hydroxyl group. Hydroxybenzaldehydes Organic compounds Organic oxygen compounds Organooxygen compounds Carbonyl compounds Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Benzoyl derivatives Hydrocarbon derivatives Organic oxides 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Benzenoid Benzoyl Hydrocarbon derivative Hydroxybenzaldehyde Monocyclic benzene moiety Organic oxide Phenol a small molecule hydroxybenzaldehyde logp 1.28 ALOGPS logs -1.08 ALOGPS solubility 1.01e+01 g/l ALOGPS logp 1.38 ChemAxon pka_strongest_acidic 8.94 ChemAxon pka_strongest_basic -6 ChemAxon iupac 3-hydroxybenzaldehyde ChemAxon average_mass 122.123 ChemAxon mono_mass 122.036779433 ChemAxon smiles OC1=CC=CC(C=O)=C1 ChemAxon formula C7H6O2 ChemAxon inchi InChI=1S/C7H6O2/c8-5-6-2-1-3-7(9)4-6/h1-5,9H ChemAxon inchikey IAVREABSGIHHMO-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 34.62 ChemAxon polarizability 11.95 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 87281 Specdb::MsMs 1035719 Specdb::MsMs 1035720 Specdb::MsMs 1035721 Specdb::MsMs 1159040 Specdb::MsMs 1159041 Specdb::MsMs 1159042 FOBI:030453