1.0 2020-04-02 17:33:48 UTC 2025-11-19 03:07:38 UTC FDB097210 2,2-dimethyl-5-(1-methyl-1-propenyl)-tetrahydrofuran C10H18O 154.253 154.1357652 5-(but-2-en-2-yl)-2,2-dimethyloxolane 5-(but-2-en-2-yl)-2,2-dimethyloxolane CC=C(C)[C@@H]1CCC(C)(C)O1 InChI=1S/C10H18O/c1-5-8(2)9-6-7-10(3,4)11-9/h5,9H,6-7H2,1-4H3/t9-/m0/s1 LPEYLSKLVYWOEQ-VIFPVBQESA-N belongs to the class of organic compounds known as oxolanes. These are organic compounds containing an oxolane (tetrahydrofuran) ring, which is a saturated aliphatic five-member ring containing one oxygen and five carbon atoms. Oxolanes Organic compounds Organoheterocyclic compounds Oxolanes Aliphatic heteromonocyclic compounds Dialkyl ethers Hydrocarbon derivatives Oxacyclic compounds Aliphatic heteromonocyclic compound Dialkyl ether Ether Hydrocarbon derivative Organic oxygen compound Organooxygen compound Oxacycle Oxolane logp 3.82 ALOGPS logs -2.55 ALOGPS solubility 4.38e-01 g/l ALOGPS logp 2.65 ChemAxon pka_strongest_basic -4.2 ChemAxon iupac 5-(but-2-en-2-yl)-2,2-dimethyloxolane ChemAxon average_mass 154.253 ChemAxon mono_mass 154.1357652 ChemAxon smiles CC=C(C)[C@@H]1CCC(C)(C)O1 ChemAxon formula C10H18O ChemAxon inchi InChI=1S/C10H18O/c1-5-8(2)9-6-7-10(3,4)11-9/h5,9H,6-7H2,1-4H3/t9-/m0/s1 ChemAxon inchikey LPEYLSKLVYWOEQ-VIFPVBQESA-N ChemAxon polar_surface_area 9.23 ChemAxon refractivity 48.4 ChemAxon polarizability 19.04 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 5790 Specdb::MsMs 240589 Specdb::MsMs 240590 Specdb::MsMs 240591 Specdb::MsMs 242644 Specdb::MsMs 242645 Specdb::MsMs 242646 Grape Type 1 specific Vitis 3603 Milk (Cow) Type 2 specific 88.8225 252.0 0.29 uM