1.0 2020-04-02 17:47:37 UTC 2025-11-19 03:07:49 UTC FDB097311 Linalool oxide (cis-pyran) C11H20O2 184.279 184.146329884 (3S,6S)-6-ethenyl-2,2,6-trimethyloxan-3-ol (3S,6S)-6-ethenyl-2,2,6-trimethyloxan-3-ol CC(C)(O)[C@@]1(C)CC[C@](C)(O1)C=C InChI=1S/C11H20O2/c1-6-10(4)7-8-11(5,13-10)9(2,3)12/h6,12H,1,7-8H2,2-5H3/t10-,11-/m1/s1 SUOCCLKULOHEBG-GHMZBOCLSA-N belongs to the class of organic compounds known as oxanes. Oxanes are compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms. Oxanes Organic compounds Organoheterocyclic compounds Oxanes Aliphatic heteromonocyclic compounds Dialkyl ethers Hydrocarbon derivatives Oxacyclic compounds Secondary alcohols Alcohol Aliphatic heteromonocyclic compound Dialkyl ether Ether Hydrocarbon derivative Organic oxygen compound Organooxygen compound Oxacycle Oxane Secondary alcohol logp 1.68 ALOGPS logs -2.03 ALOGPS solubility 1.58e+00 g/l ALOGPS logp 1.67 ChemAxon pka_strongest_acidic 14 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac (3S,6S)-6-ethenyl-2,2,6-trimethyloxan-3-ol ChemAxon average_mass 184.279 ChemAxon mono_mass 184.146329884 ChemAxon smiles CC(C)(O)[C@@]1(C)CC[C@](C)(O1)C=C ChemAxon formula C11H20O2 ChemAxon inchi InChI=1S/C11H20O2/c1-6-10(4)7-8-11(5,13-10)9(2,3)12/h6,12H,1,7-8H2,2-5H3/t10-,11-/m1/s1 ChemAxon inchikey SUOCCLKULOHEBG-GHMZBOCLSA-N ChemAxon polar_surface_area 29.46 ChemAxon refractivity 49.04 ChemAxon polarizability 19.39 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 5694 Specdb::MsMs 72330 Specdb::MsMs 72331 Specdb::MsMs 72332 Specdb::MsMs 131205 Specdb::MsMs 131206 Specdb::MsMs 131207 HMDB0031441 Grape Type 1 specific Vitis 3603 Grape wine Type 2 specific Milk (Cow) Type 2 specific 1.8625 3.0 0.7 uM