1.0 2020-04-03 05:41:21 UTC 2025-11-19 03:08:02 UTC FDB097419 p,p'-DDE C14H8Cl4 318.025 315.938011084 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]benzene p,p'-DDE ClC(Cl)=C(C1=CC=C(Cl)C=C1)C1=CC=C(Cl)C=C1 InChI=1S/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H UCNVFOCBFJOQAL-UHFFFAOYSA-N belongs to the class of organic compounds known as diphenylmethanes. Diphenylmethanes are compounds containing a diphenylmethane moiety, which consists of a methane wherein two hydrogen atoms are replaced by two phenyl groups. Diphenylmethanes Organic compounds Benzenoids Benzene and substituted derivatives Diphenylmethanes Aromatic homomonocyclic compounds Aryl chlorides Chloroalkenes Chlorobenzenes Hydrocarbon derivatives Ketene acetals Organochlorides Vinyl chlorides Aromatic homomonocyclic compound Aryl chloride Aryl halide Chloroalkene Chlorobenzene Diphenylmethane Haloalkene Halobenzene Hydrocarbon derivative Ketene acetal or derivatives Organochloride Organohalogen compound Vinyl chloride Vinyl halide Organochlorine pesticides a small molecule chlorophenylethylene monochlorobenzenes logp 6.22 ALOGPS logs -6.64 ALOGPS solubility 7.25e-05 g/l ALOGPS logp 6.11 ChemAxon iupac 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]benzene ChemAxon average_mass 318.025 ChemAxon mono_mass 315.938011084 ChemAxon smiles ClC(Cl)=C(C1=CC=C(Cl)C=C1)C1=CC=C(Cl)C=C1 ChemAxon formula C14H8Cl4 ChemAxon inchi InChI=1S/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H ChemAxon inchikey UCNVFOCBFJOQAL-UHFFFAOYSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 99.31 ChemAxon polarizability 30.79 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1027 Specdb::NmrOneD 2596 Specdb::NmrOneD 3299 Specdb::MsMs 83259 Specdb::MsMs 83260 Specdb::MsMs 83261 Specdb::MsMs 144816 Specdb::MsMs 144817 Specdb::MsMs 144818 Specdb::MsMs 3610456 Specdb::MsMs 3610457 Specdb::MsMs 3610458 Specdb::MsMs 3610459 Specdb::MsMs 3610460 Specdb::MsMs 3610461 Milk (Cow) Type 2 specific 89.07282 314.0 0.0641 uM