1.0 2020-04-03 16:32:39 UTC 2025-11-19 03:08:09 UTC FDB098117 11-Methyldodecanoic acid C13H26O2 214.349 214.193280077 11-methyldodecanoic acid isoundecylic acid CC(C)CCCCCCCCCC(O)=O InChI=1S/C13H26O2/c1-12(2)10-8-6-4-3-5-7-9-11-13(14)15/h12H,3-11H2,1-2H3,(H,14,15) SIOLDWZBFABPJU-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Branched fatty acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Branched fatty acid Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Branched fatty acids branched-chain saturated fatty acid medium-chain fatty acid methyl-branched fatty acid logp 5.25 ALOGPS logs -4.74 ALOGPS solubility 3.88e-03 g/l ALOGPS logp 4.77 ChemAxon pka_strongest_acidic 4.95 ChemAxon iupac 11-methyldodecanoic acid ChemAxon average_mass 214.349 ChemAxon mono_mass 214.193280077 ChemAxon smiles CC(C)CCCCCCCCCC(O)=O ChemAxon formula C13H26O2 ChemAxon inchi InChI=1S/C13H26O2/c1-12(2)10-8-6-4-3-5-7-9-11-13(14)15/h12H,3-11H2,1-2H3,(H,14,15) ChemAxon inchikey SIOLDWZBFABPJU-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 63.23 ChemAxon polarizability 27.68 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1276726 Specdb::MsMs 1276727 Specdb::MsMs 1276728 Specdb::MsMs 1391647 Specdb::MsMs 1391648 Specdb::MsMs 1391649 Specdb::MsMs 3610468 Specdb::MsMs 3610469 Specdb::MsMs 3610470 Specdb::MsMs 3610471 Specdb::MsMs 3610472 Specdb::MsMs 3610473 Milk (Cow) Type 2 specific