1.0 2020-04-03 17:09:06 UTC 2020-04-03 17:09:08 UTC FDB098407 10Z-Pentadecenoic acid C15H28O2 240.387 240.208930142 (10Z)-pentadec-10-enoic acid (10Z)-pentadec-10-enoic acid CCCC\C=C/CCCCCCCCC(O)=O InChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h5-6H,2-4,7-14H2,1H3,(H,16,17)/b6-5- APXSAEQXOXTDAM-WAYWQWQTSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid 10-pentadecenoic acid Unsaturated fatty acids logp 6.21 ALOGPS logs -5.38 ALOGPS solubility 1.01e-03 g/l ALOGPS logp 5.45 ChemAxon pka_strongest_acidic 5.02 ChemAxon iupac (10Z)-pentadec-10-enoic acid ChemAxon average_mass 240.387 ChemAxon mono_mass 240.208930142 ChemAxon smiles CCCC\C=C/CCCCCCCCC(O)=O ChemAxon formula C15H28O2 ChemAxon inchi InChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h5-6H,2-4,7-14H2,1H3,(H,16,17)/b6-5- ChemAxon inchikey APXSAEQXOXTDAM-WAYWQWQTSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 73.6 ChemAxon polarizability 30.84 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1289278 Specdb::MsMs 1289279 Specdb::MsMs 1289280 Specdb::MsMs 1404022 Specdb::MsMs 1404023 Specdb::MsMs 1404024 Specdb::MsMs 3610774 Specdb::MsMs 3610775 Specdb::MsMs 3610776 Specdb::MsMs 3610777 Specdb::MsMs 3610778 Specdb::MsMs 3610779 Milk (Cow) Type 2 specific