1.0 2020-04-06 11:01:11 UTC 2025-11-19 03:10:28 UTC FDB111645 D-Leucine C6H13NO2 131.1729 131.094628665 (2R)-2-amino-4-methylpentanoic acid L-(+)-leucine CC(C)C[C@@H](N)C(O)=O InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1 ROHFNLRQFUQHCH-RXMQYKEDSA-N belongs to the class of organic compounds known as leucine and derivatives. Leucine and derivatives are compounds containing leucine or a derivative thereof resulting from reaction of leucine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Leucine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids D-alpha-amino acids Hydrocarbon derivatives Methyl-branched fatty acids Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Branched fatty acid Carbonyl group Carboxylic acid D-alpha-amino acid Fatty acid Fatty acyl Hydrocarbon derivative Leucine or derivatives Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine D-alpha-amino acid Other amino acids leucine logp -1.82 ALOGPS logs -0.27 ALOGPS solubility 6.98e+01 g/l ALOGPS logp -1.6 ChemAxon pka_strongest_acidic 2.79 ChemAxon pka_strongest_basic 9.52 ChemAxon iupac (2R)-2-amino-4-methylpentanoic acid ChemAxon average_mass 131.1729 ChemAxon mono_mass 131.094628665 ChemAxon smiles CC(C)C[C@@H](N)C(O)=O ChemAxon formula C6H13NO2 ChemAxon inchi InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1 ChemAxon inchikey ROHFNLRQFUQHCH-RXMQYKEDSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 34.17 ChemAxon polarizability 14.25 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 2479 Specdb::CMs 40180 Specdb::CMs 161574 Specdb::MsMs 59226 Specdb::MsMs 59227 Specdb::MsMs 59228 Specdb::MsMs 115314 Specdb::MsMs 115315 Specdb::MsMs 115316 Specdb::MsMs 2773565 Specdb::MsMs 2773566 Specdb::MsMs 2773567 Specdb::MsMs 2905203 Specdb::MsMs 2905204 Specdb::MsMs 2905205 Specdb::NmrOneD 99898 Specdb::NmrOneD 99899 Specdb::NmrOneD 99900 Specdb::NmrOneD 99901 Specdb::NmrOneD 99902 Specdb::NmrOneD 99903 Specdb::NmrOneD 99904 Specdb::NmrOneD 99905 Specdb::NmrOneD 99906 Specdb::NmrOneD 99907 Specdb::NmrOneD 99908 Specdb::NmrOneD 99909 Specdb::NmrOneD 99910 Specdb::NmrOneD 99911 Specdb::NmrOneD 99912 Specdb::NmrOneD 99913 Specdb::NmrOneD 99914 Specdb::NmrOneD 99915 Specdb::NmrOneD 99916 Specdb::NmrOneD 99917 HMDB0013773 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823