1.0 2020-04-06 11:01:42 UTC 2025-11-19 03:10:29 UTC FDB111648 1-Nitroheptane C7H16NO2 146.2074 146.118103761 heptyl(hydroxy)oxoazanium heptyl(hydroxy)oxoazanium CCCCCCC[N+](O)=O InChI=1S/C7H16NO2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/q+1 FVLWFQZJXWIROM-UHFFFAOYSA-N belongs to the class of organic compounds known as organic nitro compounds. Organic nitro compounds are compounds having the nitro group, -NO2 (free valence on nitrogen), which may be attached to carbon, nitrogen (as in nitramines), or oxygen (as in nitrates), among other elements (in the absence of specification, C-nitro compounds are usually implied). Organic nitro compounds Organic compounds Organic 1,3-dipolar compounds Allyl-type 1,3-dipolar organic compounds Organic nitro compounds Aliphatic acyclic compounds Hydrocarbon derivatives N-organohydroxylamines Organic cations Organic oxides Organic oxoazanium compounds Organopnictogen compounds Aliphatic acyclic compound Hydrocarbon derivative N-organohydroxylamine Organic cation Organic nitro compound Organic nitrogen compound Organic oxide Organic oxoazanium Organic oxygen compound Organonitrogen compound Organopnictogen compound logp 0.50 ALOGPS logs -2.73 ALOGPS solubility 3.35e-01 g/l ALOGPS logp 0.19 ChemAxon pka_strongest_acidic 9.45 ChemAxon iupac heptyl(hydroxy)oxoazanium ChemAxon average_mass 146.2074 ChemAxon mono_mass 146.118103761 ChemAxon smiles CCCCCCC[N+](O)=O ChemAxon formula C7H16NO2 ChemAxon inchi InChI=1S/C7H16NO2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/q+1 ChemAxon inchikey FVLWFQZJXWIROM-UHFFFAOYSA-N ChemAxon polar_surface_area 40.31 ChemAxon refractivity 40.38 ChemAxon polarizability 17.01 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 1 ChemAxon Specdb::CMs 18148 Specdb::CMs 130638 Specdb::CMs 138372 Specdb::MsMs 102183 Specdb::MsMs 102184 Specdb::MsMs 102185 Specdb::MsMs 167934 Specdb::MsMs 167935 Specdb::MsMs 167936 Specdb::MsMs 2444104 Specdb::MsMs 2444105 Specdb::MsMs 2444106 HMDB0013811 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823