1.0 2020-04-06 11:01:52 UTC 2025-11-19 03:10:29 UTC FDB111649 1-Nitrohexane C6H14NO2 132.1809 132.102453697 hexyl(hydroxy)oxoazanium hexyl(hydroxy)oxoazanium CCCCCC[N+](O)=O InChI=1S/C6H14NO2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9)/q+1 RPBWECFHDHMPJN-UHFFFAOYSA-N belongs to the class of organic compounds known as organic nitro compounds. Organic nitro compounds are compounds having the nitro group, -NO2 (free valence on nitrogen), which may be attached to carbon, nitrogen (as in nitramines), or oxygen (as in nitrates), among other elements (in the absence of specification, C-nitro compounds are usually implied). Organic nitro compounds Organic compounds Organic 1,3-dipolar compounds Allyl-type 1,3-dipolar organic compounds Organic nitro compounds Aliphatic acyclic compounds Hydrocarbon derivatives N-organohydroxylamines Organic cations Organic oxides Organic oxoazanium compounds Organopnictogen compounds Aliphatic acyclic compound Hydrocarbon derivative N-organohydroxylamine Organic cation Organic nitro compound Organic nitrogen compound Organic oxide Organic oxoazanium Organic oxygen compound Organonitrogen compound Organopnictogen compound logp 0.37 ALOGPS logs -2.24 ALOGPS solubility 9.73e-01 g/l ALOGPS logp -0.26 ChemAxon pka_strongest_acidic 9.45 ChemAxon iupac hexyl(hydroxy)oxoazanium ChemAxon average_mass 132.1809 ChemAxon mono_mass 132.102453697 ChemAxon smiles CCCCCC[N+](O)=O ChemAxon formula C6H14NO2 ChemAxon inchi InChI=1S/C6H14NO2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9)/q+1 ChemAxon inchikey RPBWECFHDHMPJN-UHFFFAOYSA-N ChemAxon polar_surface_area 40.31 ChemAxon refractivity 35.78 ChemAxon polarizability 14.94 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 1 ChemAxon Specdb::MsMs 294718 Specdb::MsMs 294719 Specdb::MsMs 294720 Specdb::MsMs 2934770 Specdb::MsMs 2934771 Specdb::MsMs 2934772 Specdb::CMs 13071 Specdb::CMs 158650 Specdb::NmrOneD 99958 Specdb::NmrOneD 99959 Specdb::NmrOneD 99960 Specdb::NmrOneD 99961 Specdb::NmrOneD 99962 Specdb::NmrOneD 99963 Specdb::NmrOneD 99964 Specdb::NmrOneD 99965 Specdb::NmrOneD 99966 Specdb::NmrOneD 99967 Specdb::NmrOneD 99968 Specdb::NmrOneD 99969 Specdb::NmrOneD 99970 Specdb::NmrOneD 99971 Specdb::NmrOneD 99972 Specdb::NmrOneD 99973 Specdb::NmrOneD 99974 Specdb::NmrOneD 99975 Specdb::NmrOneD 99976 Specdb::NmrOneD 99977 HMDB0013812 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823