1.0 2020-04-06 11:03:27 UTC 2025-11-19 03:10:30 UTC FDB111658 Coutaric acid C18H27N3O4 349.4247 349.200156367 4-[(2R)-2-(aminomethyl)-2-(hydroxymethyl)-5-oxopyrrolidin-1-yl]-3-[(pentan-3-yl)amino]benzoic acid 4-[(2R)-2-(aminomethyl)-2-(hydroxymethyl)-5-oxopyrrolidin-1-yl]-3-(pentan-3-ylamino)benzoic acid CCC(CC)NC1=C(C=CC(=C1)C(O)=O)N1C(=O)CC[C@@]1(CN)CO InChI=1S/C18H27N3O4/c1-3-13(4-2)20-14-9-12(17(24)25)5-6-15(14)21-16(23)7-8-18(21,10-19)11-22/h5-6,9,13,20,22H,3-4,7-8,10-11,19H2,1-2H3,(H,24,25)/t18-/m1/s1 ZEZFFRWWHKSMEB-GOSISDBHSA-N belongs to the class of organic compounds known as coumaric acid esters. These are aromatic compounds containing an ester derivative of coumaric acid. Coumaric acid esters Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alpha hydroxy acids and derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Cinnamic acid esters Coumaric acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Monosaccharides Organic oxides Secondary alcohols Styrenes Sugar acids and derivatives Tricarboxylic acids and derivatives 1-hydroxy-2-unsubstituted benzenoid Alcohol Alpha,beta-unsaturated carboxylic ester Alpha-hydroxy acid Aromatic homomonocyclic compound Benzenoid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Coumaric acid ester Coumaric acid or derivatives Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Monocyclic benzene moiety Monosaccharide Organic oxide Organic oxygen compound Organooxygen compound Phenol Secondary alcohol Styrene Sugar acid Tricarboxylic acid or derivatives logp 0.05 ALOGPS logs -2.42 ALOGPS solubility 1.33e+00 g/l ALOGPS logp -1.5 ChemAxon pka_strongest_acidic 4.94 ChemAxon pka_strongest_basic 8.68 ChemAxon iupac 4-[(2R)-2-(aminomethyl)-2-(hydroxymethyl)-5-oxopyrrolidin-1-yl]-3-[(pentan-3-yl)amino]benzoic acid ChemAxon average_mass 349.4247 ChemAxon mono_mass 349.200156367 ChemAxon smiles CCC(CC)NC1=C(C=CC(=C1)C(O)=O)N1C(=O)CC[C@@]1(CN)CO ChemAxon formula C18H27N3O4 ChemAxon inchi InChI=1S/C18H27N3O4/c1-3-13(4-2)20-14-9-12(17(24)25)5-6-15(14)21-16(23)7-8-18(21,10-19)11-22/h5-6,9,13,20,22H,3-4,7-8,10-11,19H2,1-2H3,(H,24,25)/t18-/m1/s1 ChemAxon inchikey ZEZFFRWWHKSMEB-GOSISDBHSA-N ChemAxon polar_surface_area 115.89 ChemAxon refractivity 96.4 ChemAxon polarizability 37.07 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 15142 Specdb::NmrOneD 15143 Specdb::NmrOneD 15144 Specdb::NmrOneD 15145 Specdb::NmrOneD 15146 Specdb::NmrOneD 15147 Specdb::NmrOneD 15148 Specdb::NmrOneD 15149 Specdb::NmrOneD 15150 Specdb::NmrOneD 15151 Specdb::NmrOneD 15152 Specdb::NmrOneD 15153 Specdb::NmrOneD 15154 Specdb::NmrOneD 15155 Specdb::NmrOneD 15156 Specdb::NmrOneD 15157 Specdb::NmrOneD 15158 Specdb::NmrOneD 15159 Specdb::NmrOneD 15160 Specdb::NmrOneD 15161 Specdb::CMs 20311 Specdb::CMs 41205 Specdb::CMs 157075 Specdb::MsMs 178347 Specdb::MsMs 178348 Specdb::MsMs 178349 Specdb::MsMs 180663 Specdb::MsMs 180664 Specdb::MsMs 180665 Specdb::MsMs 2706317 Specdb::MsMs 2706318 Specdb::MsMs 2706319 Specdb::MsMs 2999395 Specdb::MsMs 2999396 Specdb::MsMs 2999397 HMDB0029225 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823