1.0 2020-04-06 11:04:30 UTC 2025-11-19 03:10:31 UTC FDB111664 2-Isopropoxyphenol C9H12O2 152.1904 152.083729628 2-(propan-2-yloxy)phenol 2-isopropoxyphenol CC(C)OC1=CC=CC=C1O InChI=1S/C9H12O2/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7,10H,1-2H3 ZNCUUYCDKVNVJH-UHFFFAOYSA-N belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. Phenol ethers Organic compounds Benzenoids Phenol ethers Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alkyl aryl ethers Hydrocarbon derivatives Phenoxy compounds 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alkyl aryl ether Aromatic homomonocyclic compound Ether Hydrocarbon derivative Monocyclic benzene moiety Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound aromatic ether phenols logp 2.27 ALOGPS logs -1.58 ALOGPS solubility 3.97e+00 g/l ALOGPS logp 2.29 ChemAxon pka_strongest_acidic 9.95 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 2-(propan-2-yloxy)phenol ChemAxon average_mass 152.1904 ChemAxon mono_mass 152.083729628 ChemAxon smiles CC(C)OC1=CC=CC=C1O ChemAxon formula C9H12O2 ChemAxon inchi InChI=1S/C9H12O2/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7,10H,1-2H3 ChemAxon inchikey ZNCUUYCDKVNVJH-UHFFFAOYSA-N ChemAxon polar_surface_area 29.46 ChemAxon refractivity 43.67 ChemAxon polarizability 16.55 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 9387 Specdb::MsIr 9388 Specdb::MsIr 9389 Specdb::CMs 19217 Specdb::CMs 47565 Specdb::CMs 137379 Specdb::CMs 145113 Specdb::MsMs 110112 Specdb::MsMs 110113 Specdb::MsMs 110114 Specdb::MsMs 177708 Specdb::MsMs 177709 Specdb::MsMs 177710 Specdb::MsMs 2265243 Specdb::MsMs 2265244 Specdb::MsMs 2265245 Specdb::MsMs 3074310 Specdb::MsMs 3074311 Specdb::MsMs 3074312 Specdb::NmrOneD 49962 Specdb::NmrOneD 49963 Specdb::NmrOneD 49964 Specdb::NmrOneD 49965 Specdb::NmrOneD 49966 Specdb::NmrOneD 49967 Specdb::NmrOneD 49968 Specdb::NmrOneD 49969 Specdb::NmrOneD 49970 Specdb::NmrOneD 49971 Specdb::NmrOneD 49972 Specdb::NmrOneD 49973 Specdb::NmrOneD 49974 Specdb::NmrOneD 49975 Specdb::NmrOneD 49976 Specdb::NmrOneD 49977 Specdb::NmrOneD 49978 Specdb::NmrOneD 49979 Specdb::NmrOneD 49980 Specdb::NmrOneD 49981 HMDB0041804 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823