1.0 2020-04-06 11:08:17 UTC 2025-11-19 03:10:35 UTC FDB111686 Norpropoxyphene C21H27NO2 325.4446 325.204179113 3-methyl-4-(methylamino)-1,2-diphenylbutan-2-yl propanoate norpropoxyphene CCC(=O)OC(CC1=CC=CC=C1)(C(C)CNC)C1=CC=CC=C1 InChI=1S/C21H27NO2/c1-4-20(23)24-21(17(2)16-22-3,19-13-9-6-10-14-19)15-18-11-7-5-8-12-18/h5-14,17,22H,4,15-16H2,1-3H3 IKACRWYHQXOSGM-UHFFFAOYSA-N belongs to the class of organic compounds known as stilbenes. These are organic compounds containing a 1,2-diphenylethylene moiety. Stilbenes (C6-C2-C6 ) are derived from the common phenylpropene (C6-C3) skeleton building block. The introduction of one or more hydroxyl groups to a phenyl ring lead to stilbenoids. Stilbenes Organic compounds Phenylpropanoids and polyketides Stilbenes Aromatic homomonocyclic compounds Amino acids and derivatives Aralkylamines Benzyloxycarbonyls Carbonyl compounds Carboxylic acid esters Dialkylamines Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Phenylbutylamines Phenylpropanes Amine Amino acid or derivatives Aralkylamine Aromatic homomonocyclic compound Benzenoid Benzyloxycarbonyl Carbonyl group Carboxylic acid derivative Carboxylic acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylbutylamine Phenylpropane Secondary aliphatic amine Secondary amine Stilbene logp 4.45 ALOGPS logs -5.25 ALOGPS solubility 1.82e-03 g/l ALOGPS logp 4.52 ChemAxon pka_strongest_basic 10.17 ChemAxon iupac 3-methyl-4-(methylamino)-1,2-diphenylbutan-2-yl propanoate ChemAxon average_mass 325.4446 ChemAxon mono_mass 325.204179113 ChemAxon smiles CCC(=O)OC(CC1=CC=CC=C1)(C(C)CNC)C1=CC=CC=C1 ChemAxon formula C21H27NO2 ChemAxon inchi InChI=1S/C21H27NO2/c1-4-20(23)24-21(17(2)16-22-3,19-13-9-6-10-14-19)15-18-11-7-5-8-12-18/h5-14,17,22H,4,15-16H2,1-3H3 ChemAxon inchikey IKACRWYHQXOSGM-UHFFFAOYSA-N ChemAxon polar_surface_area 38.33 ChemAxon refractivity 97.59 ChemAxon polarizability 37.17 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 17884 Specdb::CMs 155904 Specdb::MsMs 305608 Specdb::MsMs 305609 Specdb::MsMs 305610 Specdb::MsMs 349039 Specdb::MsMs 349040 Specdb::MsMs 349041 Specdb::MsMs 449287 Specdb::MsMs 449288 Specdb::MsMs 449289 Specdb::MsMs 449290 Specdb::MsMs 449291 Specdb::MsMs 2252425 Specdb::MsMs 2254051 Specdb::MsMs 2254522 Specdb::MsMs 2256062 Specdb::MsMs 2256449 Specdb::MsMs 2260154 Specdb::MsMs 2825959 Specdb::MsMs 2825960 Specdb::MsMs 2825961 Specdb::MsMs 2856972 Specdb::MsMs 2856973 Specdb::MsMs 2856974 HMDB0041962 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823