1.0 2020-04-06 11:16:50 UTC 2025-11-19 03:10:42 UTC FDB111734 3-Iodothyronamine C14H14INO2 355.1709 355.006922117 4-[4-(2-aminoethyl)-2-iodophenoxy]phenol 3-iodothyronamine NCCC1=CC(I)=C(OC2=CC=C(O)C=C2)C=C1 InChI=1S/C14H14INO2/c15-13-9-10(7-8-16)1-6-14(13)18-12-4-2-11(17)3-5-12/h1-6,9,17H,7-8,16H2 XIINYOJWNGOUPF-UHFFFAOYSA-N belongs to the class of organic compounds known as diphenylethers. These are aromatic compounds containing two benzene rings linked to each other through an ether group. Diphenylethers Organic compounds Benzenoids Benzene and substituted derivatives Diphenylethers Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 2-arylethylamines Aralkylamines Aryl iodides Diarylethers Hydrocarbon derivatives Iodobenzenes Monoalkylamines Organoiodides Organopnictogen compounds Phenethylamines Phenol ethers Phenoxy compounds 1-hydroxy-2-unsubstituted benzenoid 2-arylethylamine Amine Aralkylamine Aromatic homomonocyclic compound Aryl halide Aryl iodide Diaryl ether Diphenylether Ether Halobenzene Hydrocarbon derivative Iodobenzene Organic nitrogen compound Organic oxygen compound Organohalogen compound Organoiodide Organonitrogen compound Organooxygen compound Organopnictogen compound Phenethylamine Phenol Phenol ether Phenoxy compound Primary aliphatic amine Primary amine logp 3.74 ALOGPS logs -4.05 ALOGPS solubility 3.17e-02 g/l ALOGPS logp 2.88 ChemAxon pka_strongest_acidic 9.43 ChemAxon pka_strongest_basic 10.04 ChemAxon iupac 4-[4-(2-aminoethyl)-2-iodophenoxy]phenol ChemAxon average_mass 355.1709 ChemAxon mono_mass 355.006922117 ChemAxon smiles NCCC1=CC(I)=C(OC2=CC=C(O)C=C2)C=C1 ChemAxon formula C14H14INO2 ChemAxon inchi InChI=1S/C14H14INO2/c15-13-9-10(7-8-16)1-6-14(13)18-12-4-2-11(17)3-5-12/h1-6,9,17H,7-8,16H2 ChemAxon inchikey XIINYOJWNGOUPF-UHFFFAOYSA-N ChemAxon polar_surface_area 55.48 ChemAxon refractivity 80.87 ChemAxon polarizability 30.39 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 33550 Specdb::CMs 48273 Specdb::CMs 130475 Specdb::CMs 138209 Specdb::MsMs 884656 Specdb::MsMs 884657 Specdb::MsMs 884658 Specdb::MsMs 925600 Specdb::MsMs 925601 Specdb::MsMs 925602 Specdb::MsMs 3225796 Specdb::MsMs 3225797 Specdb::MsMs 3225798 Specdb::MsMs 3225799 Specdb::MsMs 3225800 Specdb::MsMs 3225801 HMDB0060524 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823