1.0 2020-04-06 11:38:50 UTC 2020-04-06 23:43:21 UTC FDB111860 Glutamylaspartic acid C9H14N2O7 262.218 262.080100799 (2S)-2-[(2S)-2-amino-4-carboxybutanamido]butanedioic acid (2S)-2-[(2S)-2-amino-4-carboxybutanamido]butanedioic acid N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(O)=O InChI=1S/C9H14N2O7/c10-4(1-2-6(12)13)8(16)11-5(9(17)18)3-7(14)15/h4-5H,1-3,10H2,(H,11,16)(H,12,13)(H,14,15)(H,17,18)/t4-,5-/m0/s1 FYYSIASRLDJUNP-WHFBIAKZSA-N belongs to the class of organic compounds known as hybrid peptides. Hybrid peptides are compounds containing at least two different types of amino acids (alpha, beta, gamma, delta) linked to each other through a peptide bond. Hybrid peptides Organic compounds Organic acids and derivatives Peptidomimetics Hybrid peptides Aliphatic acyclic compounds Acyl L-homoserines Amino acids Amino fatty acids Aspartic acid and derivatives Carbonyl compounds Carboximidic acids Carboxylic acids Gamma amino acids and derivatives Hydrocarbon derivatives Monoalkylamines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Tricarboxylic acids and derivatives Acyl-homoserine Acyl-l-homoserine Aliphatic acyclic compound Alpha-amino acid or derivatives Amine Amino acid Amino acid or derivatives Amino fatty acid Aspartic acid or derivatives Carbonyl group Carboximidic acid Carboximidic acid derivative Carboxylic acid Carboxylic acid derivative Fatty acyl Gamma amino acid or derivatives Hybrid peptide Hydrocarbon derivative N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Propargyl-type 1,3-dipolar organic compound Tricarboxylic acid or derivatives dipeptide logp -3.24 ALOGPS logs -1.45 ALOGPS solubility 9.23e+00 g/l ALOGPS logp -4.6 ChemAxon pka_strongest_acidic 2.98 ChemAxon pka_strongest_basic 8.45 ChemAxon iupac (2S)-2-[(2S)-2-amino-4-carboxybutanamido]butanedioic acid ChemAxon average_mass 262.218 ChemAxon mono_mass 262.080100799 ChemAxon smiles N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(O)=O ChemAxon formula C9H14N2O7 ChemAxon inchi InChI=1S/C9H14N2O7/c10-4(1-2-6(12)13)8(16)11-5(9(17)18)3-7(14)15/h4-5H,1-3,10H2,(H,11,16)(H,12,13)(H,14,15)(H,17,18)/t4-,5-/m0/s1 ChemAxon inchikey FYYSIASRLDJUNP-WHFBIAKZSA-N ChemAxon polar_surface_area 167.02 ChemAxon refractivity 54.62 ChemAxon polarizability 23.63 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 167497 Specdb::MsMs 1262560 Specdb::MsMs 1262561 Specdb::MsMs 1262562 Specdb::MsMs 1377673 Specdb::MsMs 1377674 Specdb::MsMs 1377675 Specdb::MsMs 3223495 Specdb::MsMs 3223496 Specdb::MsMs 3223497 Specdb::MsMs 3223498 Specdb::MsMs 3223499 Specdb::MsMs 3223500 Specdb::NmrOneD 155250 Specdb::NmrOneD 155251 Specdb::NmrOneD 155252 Specdb::NmrOneD 155253 Specdb::NmrOneD 155254 Specdb::NmrOneD 155255 Specdb::NmrOneD 155256 Specdb::NmrOneD 155257 Specdb::NmrOneD 155258 Specdb::NmrOneD 155259 Specdb::NmrOneD 155260 Specdb::NmrOneD 155261 Specdb::NmrOneD 155262 Specdb::NmrOneD 155263 Specdb::NmrOneD 155264 Specdb::NmrOneD 155265 Specdb::NmrOneD 155266 Specdb::NmrOneD 155267 Specdb::NmrOneD 155268 Specdb::NmrOneD 155269 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823