1.0 2020-04-06 12:07:27 UTC 2025-11-19 03:11:06 UTC FDB112025 Phenylalanyl-Gamma-glutamate C14H19N3O4 293.3184 293.137556111 2-amino-5-(2-amino-3-phenylpropanamido)-5-oxopentanoic acid 2-amino-5-(2-amino-3-phenylpropanamido)-5-oxopentanoic acid NC(CCC(=O)NC(=O)C(N)CC1=CC=CC=C1)C(O)=O InChI=1S/C14H19N3O4/c15-10(14(20)21)6-7-12(18)17-13(19)11(16)8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,15-16H2,(H,20,21)(H,17,18,19) XWHWNYMBZXDFRP-UHFFFAOYSA-N belongs to the class of organic compounds known as phenylalanine and derivatives. Phenylalanine and derivatives are compounds containing phenylalanine or a derivative thereof resulting from reaction of phenylalanine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Phenylalanine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Alpha amino acid amides Alpha amino acids Amino acids Amphetamines and derivatives Aralkylamines Carbonyl compounds Carboxylic acids Dicarboximides Glutamine and derivatives Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives N-acyl amines N-unsubstituted carboxylic acid imides Organic oxides Organopnictogen compounds Alpha-amino acid Alpha-amino acid amide Amine Amino acid Amphetamine or derivatives Aralkylamine Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid imide Carboxylic acid imide, n-unsubstituted Dicarboximide Glutamine or derivatives Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalanine or derivatives Primary aliphatic amine Primary amine logp -1.61 ALOGPS logs -3.13 ALOGPS solubility 2.16e-01 g/l ALOGPS logp -2.7 ChemAxon pka_strongest_acidic 2 ChemAxon pka_strongest_basic 9.41 ChemAxon iupac 2-amino-5-(2-amino-3-phenylpropanamido)-5-oxopentanoic acid ChemAxon average_mass 293.3184 ChemAxon mono_mass 293.137556111 ChemAxon smiles NC(CCC(=O)NC(=O)C(N)CC1=CC=CC=C1)C(O)=O ChemAxon formula C14H19N3O4 ChemAxon inchi InChI=1S/C14H19N3O4/c15-10(14(20)21)6-7-12(18)17-13(19)11(16)8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,15-16H2,(H,20,21)(H,17,18,19) ChemAxon inchikey XWHWNYMBZXDFRP-UHFFFAOYSA-N ChemAxon polar_surface_area 135.51 ChemAxon refractivity 75.15 ChemAxon polarizability 30.14 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 107078 Specdb::NmrOneD 107079 Specdb::NmrOneD 107080 Specdb::NmrOneD 107081 Specdb::NmrOneD 107082 Specdb::NmrOneD 107083 Specdb::NmrOneD 107084 Specdb::NmrOneD 107085 Specdb::NmrOneD 107086 Specdb::NmrOneD 107087 Specdb::NmrOneD 107088 Specdb::NmrOneD 107089 Specdb::NmrOneD 107090 Specdb::NmrOneD 107091 Specdb::NmrOneD 107092 Specdb::NmrOneD 107093 Specdb::NmrOneD 107094 Specdb::NmrOneD 107095 Specdb::NmrOneD 107096 Specdb::NmrOneD 107097 Specdb::CMs 23738 Specdb::CMs 41050 Specdb::CMs 149942 Specdb::MsMs 318607 Specdb::MsMs 318608 Specdb::MsMs 318609 Specdb::MsMs 365425 Specdb::MsMs 365426 Specdb::MsMs 365427 Specdb::MsMs 2277318 Specdb::MsMs 2277319 Specdb::MsMs 2277320 Specdb::MsMs 3088147 Specdb::MsMs 3088148 Specdb::MsMs 3088149 HMDB0029009 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823