1.0 2020-04-20 17:32:07 UTC 2025-11-19 03:11:19 UTC FDB112182 Se-Methylselenocysteine C4H9NO2Se 182.08 182.979850365 (2R)-2-amino-3-(methylselanyl)propanoic acid methylselenocysteine C[Se]C[C@H](N)C(O)=O InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 XDSSPSLGNGIIHP-VKHMYHEASA-N belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. L-alpha-amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Selenoethers Aliphatic acyclic compound Amine Amino acid Carbonyl group Carboxylic acid Hydrocarbon derivative L-alpha-amino acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organoselenium compound Primary aliphatic amine Primary amine Selenoether L-selenocysteine derivative Se-methylselenocysteine non-proteinogenic L-alpha-amino acid logp -2.83 ALOGPS logs -0.07 ALOGPS solubility 1.56e+02 g/l ALOGPS logp -3.5 ChemAxon pka_strongest_acidic 1.46 ChemAxon pka_strongest_basic 8.4 ChemAxon iupac (2R)-2-amino-3-(methylselanyl)propanoic acid ChemAxon average_mass 182.08 ChemAxon mono_mass 182.979850365 ChemAxon smiles C[Se]C[C@H](N)C(O)=O ChemAxon formula C4H9NO2Se ChemAxon inchi InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 ChemAxon inchikey XDSSPSLGNGIIHP-VKHMYHEASA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 38.2 ChemAxon polarizability 12.89 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2141 Specdb::MsIr 2142 Specdb::MsIr 2143 Specdb::MsMs 26873 Specdb::MsMs 26874 Specdb::MsMs 26875 Specdb::MsMs 33431 Specdb::MsMs 33432 Specdb::MsMs 33433 Specdb::MsMs 2797280 Specdb::MsMs 2797281 Specdb::MsMs 2797282 Specdb::MsMs 2881733 Specdb::MsMs 2881734 Specdb::MsMs 2881735 Specdb::CMs 1070 Specdb::CMs 1163 Specdb::CMs 3284 Specdb::CMs 31504 Specdb::CMs 31505 Specdb::CMs 38717 Specdb::CMs 160877 Specdb::NmrOneD 41642 Specdb::NmrOneD 41643 Specdb::NmrOneD 41644 Specdb::NmrOneD 41645 Specdb::NmrOneD 41646 Specdb::NmrOneD 41647 Specdb::NmrOneD 41648 Specdb::NmrOneD 41649 Specdb::NmrOneD 41650 Specdb::NmrOneD 41651 Specdb::NmrOneD 41652 Specdb::NmrOneD 41653 Specdb::NmrOneD 41654 Specdb::NmrOneD 41655 Specdb::NmrOneD 41656 Specdb::NmrOneD 41657 Specdb::NmrOneD 41658 Specdb::NmrOneD 41659 Specdb::NmrOneD 41660 Specdb::NmrOneD 41661 HMDB0004113 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823