1.0 2020-04-20 17:44:44 UTC 2025-11-19 03:11:22 UTC FDB112202 Dolichyl b-D-glucosyl phosphate C21H39O9P 466.5027 466.233169358 {[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}({[(6Z)-3,7,11-trimethyldodeca-6,10-dien-1-yl]oxy})phosphinic acid dolichyl phosphate glucose CC(CCOP(O)(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CC\C=C(\C)CCC=C(C)C InChI=1S/C21H39O9P/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-28-31(26,27)30-21-20(25)19(24)18(23)17(13-22)29-21/h7,9,16-25H,5-6,8,10-13H2,1-4H3,(H,26,27)/b15-9-/t16?,17-,18-,19+,20-,21+/m1/s1 RHJMCOLWMXJOGE-ZTZGTLKASA-N belongs to the class of organic compounds known as sesquiterpenoids. These are terpenes with three consecutive isoprene units. Sesquiterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Sesquiterpenoids Aliphatic heteromonocyclic compounds Dialkyl phosphates Hexoses Hydrocarbon derivatives Monosaccharide phosphates Organic oxides Oxacyclic compounds Oxanes Polyols Primary alcohols Secondary alcohols Alcohol Aliphatic heteromonocyclic compound Alkyl phosphate Dialkyl phosphate Farsesane sesquiterpenoid Hexose monosaccharide Hydrocarbon derivative Monosaccharide Monosaccharide phosphate Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organoheterocyclic compound Organooxygen compound Oxacycle Oxane Phosphoric acid ester Polyol Primary alcohol Secondary alcohol Sesquiterpenoid logp 1.78 ALOGPS logs -2.88 ALOGPS solubility 6.18e-01 g/l ALOGPS logp 2.25 ChemAxon pka_strongest_acidic 1.62 ChemAxon pka_strongest_basic -3 ChemAxon iupac {[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}({[(6Z)-3,7,11-trimethyldodeca-6,10-dien-1-yl]oxy})phosphinic acid ChemAxon average_mass 466.5027 ChemAxon mono_mass 466.233169358 ChemAxon smiles CC(CCOP(O)(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CC\C=C(\C)CCC=C(C)C ChemAxon formula C21H39O9P ChemAxon inchi InChI=1S/C21H39O9P/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-28-31(26,27)30-21-20(25)19(24)18(23)17(13-22)29-21/h7,9,16-25H,5-6,8,10-13H2,1-4H3,(H,26,27)/b15-9-/t16?,17-,18-,19+,20-,21+/m1/s1 ChemAxon inchikey RHJMCOLWMXJOGE-ZTZGTLKASA-N ChemAxon polar_surface_area 145.91 ChemAxon refractivity 117.31 ChemAxon polarizability 49.65 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 7 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22029 Specdb::CMs 37906 Specdb::CMs 169079 Specdb::MsMs 314899 Specdb::MsMs 314900 Specdb::MsMs 314901 Specdb::MsMs 360745 Specdb::MsMs 360746 Specdb::MsMs 360747 Specdb::MsMs 2682054 Specdb::MsMs 2682055 Specdb::MsMs 2682056 Specdb::MsMs 3027063 Specdb::MsMs 3027064 Specdb::MsMs 3027065 HMDB0001054 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823