1.0 2020-04-20 18:00:05 UTC 2025-11-19 03:11:26 UTC FDB112229 13-cis Retinol C20H30O 286.4516 286.229665582 (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol 13-cis retinol C\C(=C\CO)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13- FPIPGXGPPPQFEQ-HWCYFHEPSA-N belongs to the class of organic compounds known as retinoids. These are oxygenated derivatives of 3,7-dimethyl-1-(2,6,6-trimethylcyclohex-1-enyl)nona-1,3,5,7-tetraene and derivatives thereof. Retinoids Organic compounds Lipids and lipid-like molecules Prenol lipids Retinoids Aliphatic homomonocyclic compounds Diterpenoids Fatty alcohols Hydrocarbon derivatives Primary alcohols Alcohol Aliphatic homomonocyclic compound Diterpenoid Fatty acyl Fatty alcohol Hydrocarbon derivative Organic oxygen compound Organooxygen compound Primary alcohol Retinoid skeleton Retinoids retinol logp 6.38 ALOGPS logs -4.58 ALOGPS solubility 7.58e-03 g/l ALOGPS logp 4.69 ChemAxon pka_strongest_acidic 16.44 ChemAxon pka_strongest_basic -2.2 ChemAxon iupac (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol ChemAxon average_mass 286.4516 ChemAxon mono_mass 286.229665582 ChemAxon smiles C\C(=C\CO)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C ChemAxon formula C20H30O ChemAxon inchi InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13- ChemAxon inchikey FPIPGXGPPPQFEQ-HWCYFHEPSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 97.92 ChemAxon polarizability 36.28 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1998 Specdb::NmrTwoD 2027 Specdb::CMs 21999 Specdb::CMs 38969 Specdb::CMs 174214 Specdb::MsMs 314854 Specdb::MsMs 314855 Specdb::MsMs 314856 Specdb::MsMs 360676 Specdb::MsMs 360677 Specdb::MsMs 360678 Specdb::MsMs 1218230 Specdb::MsMs 1218231 Specdb::MsMs 1218232 Specdb::MsMs 2702691 Specdb::MsMs 2702692 Specdb::MsMs 2702693 Specdb::MsMs 3002209 Specdb::MsMs 3002210 Specdb::MsMs 3002211 HMDB0006221 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823