1.0 2026-09-21 15:22:36 UTC 2026-09-21 15:22:36 UTC FDB116649 3',4',5'-Trimethoxyacetophenone 1-(3,4,5-trimethoxyphenyl)ethanone C11H14O4 210.229 210.089208931 1-(3,4,5-trimethoxyphenyl)ethan-1-one 1-(3,4,5-trimethoxyphenyl)ethanone COC1=CC(=CC(OC)=C1OC)C(C)=O InChI=1S/C11H14O4/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3/h5-6H,1-4H3 VUGQIIQFXCXZJU-UHFFFAOYSA-N belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. Alkyl-phenylketones Organic compounds Organic oxygen compounds Organooxygen compounds Carbonyl compounds Aromatic homomonocyclic compounds Acetophenones Alkyl aryl ethers Anisoles Aryl alkyl ketones Benzoyl derivatives Hydrocarbon derivatives Methoxybenzenes Organic oxides Phenoxy compounds Acetophenone Alkyl aryl ether Alkyl-phenylketone Anisole Aromatic homomonocyclic compound Aryl alkyl ketone Benzenoid Benzoyl Ether Hydrocarbon derivative Methoxybenzene Monocyclic benzene moiety Organic oxide Phenol ether Phenoxy compound acetophenones methoxybenzene logp 1.64 ALOGPS logs -2.36 ALOGPS solubility 9.11e-01 g/l ALOGPS logp 1.06 ChemAxon pka_strongest_acidic 16.01 ChemAxon pka_strongest_basic -4.5 ChemAxon iupac 1-(3,4,5-trimethoxyphenyl)ethan-1-one ChemAxon average_mass 210.229 ChemAxon mono_mass 210.089208931 ChemAxon smiles COC1=CC(=CC(OC)=C1OC)C(C)=O ChemAxon formula C11H14O4 ChemAxon inchi InChI=1S/C11H14O4/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3/h5-6H,1-4H3 ChemAxon inchikey VUGQIIQFXCXZJU-UHFFFAOYSA-N ChemAxon polar_surface_area 44.76 ChemAxon refractivity 55.85 ChemAxon polarizability 21.85 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon