1.0 2026-09-21 18:21:15 UTC 2026-09-21 18:21:15 UTC FDB116888 Ethyltrimethylpyrazine 2-ethyl-3,5,6-trimethyl-pyrazine 2-ethyl-3,5,6-trimethylpyrazine C9H14N2 150.225 150.115698459 2-ethyl-3,5,6-trimethylpyrazine 2-ethyl-3,5,6-trimethylpyrazine CCC1=NC(C)=C(C)N=C1C InChI=1S/C9H14N2/c1-5-9-8(4)10-6(2)7(3)11-9/h5H2,1-4H3 FPOLJKZKOKXIFE-UHFFFAOYSA-N belongs to the class of organic compounds known as pyrazines. Pyrazines are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. Pyrazines Organic compounds Organoheterocyclic compounds Diazines Pyrazines Aromatic heteromonocyclic compounds Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Organonitrogen compounds Organopnictogen compounds Aromatic heteromonocyclic compound Azacycle Heteroaromatic compound Hydrocarbon derivative Organic nitrogen compound Organonitrogen compound Organopnictogen compound Pyrazine logp 1.94 ALOGPS logs -1.42 ALOGPS solubility 5.72e+00 g/l ALOGPS logp 0.76 ChemAxon pka_strongest_basic 2.09 ChemAxon iupac 2-ethyl-3,5,6-trimethylpyrazine ChemAxon average_mass 150.225 ChemAxon mono_mass 150.115698459 ChemAxon smiles CCC1=NC(C)=C(C)N=C1C ChemAxon formula C9H14N2 ChemAxon inchi InChI=1S/C9H14N2/c1-5-9-8(4)10-6(2)7(3)11-9/h5H2,1-4H3 ChemAxon inchikey FPOLJKZKOKXIFE-UHFFFAOYSA-N ChemAxon polar_surface_area 25.78 ChemAxon refractivity 44.74 ChemAxon polarizability 17.97 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon