1.0 2026-09-21 19:26:41 UTC 2026-09-21 19:26:41 UTC FDB116967 N-(2-Aminoethyl)glycine 2-(2-aminoethylamino)acetic acid C4H10N2O2 118.136 118.07422757 2-[(2-aminoethyl)amino]acetic acid [(2-aminoethyl)amino]acetic acid NCCNCC(O)=O InChI=1S/C4H10N2O2/c5-1-2-6-3-4(7)8/h6H,1-3,5H2,(H,7,8) PIINGYXNCHTJTF-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Dialkylamines Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary aliphatic amine Secondary amine logp -3.30 ALOGPS logs 0.36 ALOGPS solubility 2.69e+02 g/l ALOGPS logp -4 ChemAxon pka_strongest_acidic 2.17 ChemAxon pka_strongest_basic 10.06 ChemAxon iupac 2-[(2-aminoethyl)amino]acetic acid ChemAxon average_mass 118.136 ChemAxon mono_mass 118.07422757 ChemAxon smiles NCCNCC(O)=O ChemAxon formula C4H10N2O2 ChemAxon inchi InChI=1S/C4H10N2O2/c5-1-2-6-3-4(7)8/h6H,1-3,5H2,(H,7,8) ChemAxon inchikey PIINGYXNCHTJTF-UHFFFAOYSA-N ChemAxon polar_surface_area 75.35 ChemAxon refractivity 28.73 ChemAxon polarizability 11.9 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon