1.0 2026-09-21 19:29:15 UTC 2026-09-21 19:29:15 UTC FDB116970 2-indolylacetic acid 2-(1H-indol-2-yl)acetic acid C10H9NO2 175.184 175.063328537 2-(1H-indol-2-yl)acetic acid 1H-indol-2-ylacetic acid OC(=O)CC1=CC2=CC=CC=C2N1 InChI=1S/C10H9NO2/c12-10(13)6-8-5-7-3-1-2-4-9(7)11-8/h1-5,11H,6H2,(H,12,13) QOPBEBWGSGFROG-UHFFFAOYSA-N belongs to the class of organic compounds known as indolyl carboxylic acids and derivatives. Indolyl carboxylic acids and derivatives are compounds containing a carboxylic acid chain (of at least 2 carbon atoms) linked to an indole ring. Indolyl carboxylic acids and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Indolyl carboxylic acids and derivatives Aromatic heteropolycyclic compounds Azacyclic compounds Benzenoids Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Indoles Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Substituted pyrroles Aromatic heteropolycyclic compound Azacycle Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Indole Indolyl carboxylic acid derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole Substituted pyrrole logp 1.78 ALOGPS logs -2.15 ALOGPS solubility 1.24e+00 g/l ALOGPS logp 1.63 ChemAxon pka_strongest_acidic 4.65 ChemAxon iupac 2-(1H-indol-2-yl)acetic acid ChemAxon average_mass 175.184 ChemAxon mono_mass 175.063328537 ChemAxon smiles OC(=O)CC1=CC2=CC=CC=C2N1 ChemAxon formula C10H9NO2 ChemAxon inchi InChI=1S/C10H9NO2/c12-10(13)6-8-5-7-3-1-2-4-9(7)11-8/h1-5,11H,6H2,(H,12,13) ChemAxon inchikey QOPBEBWGSGFROG-UHFFFAOYSA-N ChemAxon polar_surface_area 53.09 ChemAxon refractivity 48.33 ChemAxon polarizability 18.14 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 112979 Specdb::CMs 126599 Specdb::CMs 915731 Specdb::CMs 915732 Specdb::CMs 915733 Specdb::CMs 915734 Specdb::MsMs 1314904 Specdb::MsMs 1314905 Specdb::MsMs 1314906 Specdb::MsMs 1429378 Specdb::MsMs 1429379 Specdb::MsMs 1429380 Specdb::MsMs 3439783 Specdb::MsMs 3439784 Specdb::MsMs 3439785 Specdb::MsMs 3439786 Specdb::MsMs 3439787 Specdb::MsMs 3439788