1.0 2026-09-21 20:05:19 UTC 2026-09-21 20:05:51 UTC FDB117020 methoxycinnamaldehyde 2-methoxy-3-phenyl-prop-2-enal 2-methoxy-3-phenylprop-2-enal C10H10O2 InChI=1S/C10H10O2/c1-12-10(8-11)7-9-5-3-2-4-6-9/h2-8H,1H3 KPNHONAEPLEAJL-UHFFFAOYSA-N belongs to the class of organic compounds known as cinnamaldehydes. These are organic aromatic compounds containing a cinnamlaldehyde moiety, consisting of a benzene and an aldehyde group to form 3-phenylprop-2-enal. Cinnamaldehydes Organic compounds Phenylpropanoids and polyketides Cinnamaldehydes Aromatic homomonocyclic compounds Aldehydes Benzene and substituted derivatives Enals Hydrocarbon derivatives Organic oxides Aldehyde Alpha,beta-unsaturated aldehyde Aromatic homomonocyclic compound Benzenoid Carbonyl group Cinnamaldehyde Enal Hydrocarbon derivative Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound formula C10H10O2 ChemAxon inchi InChI=1S/C10H10O2/c1-12-10(8-11)7-9-5-3-2-4-6-9/h2-8H,1H3 ChemAxon inchikey KPNHONAEPLEAJL-UHFFFAOYSA-N ChemAxon