1.0 2026-09-21 20:53:59 UTC 2026-09-21 20:54:36 UTC FDB117084 1-Allyl-2-isopropyldisulfane 2-(allyldisulfanyl)propane 2-(prop-2-enyldisulfanyl)propane C6H12S2 InChI=1S/C6H12S2/c1-4-5-7-8-6(2)3/h4,6H,1,5H2,2-3H3 BQMYJJMTHCLMRB-UHFFFAOYSA-N belongs to the class of organic compounds known as allyl sulfur compounds. Allyl sulfur compounds are compounds containing an allylsulfur group, with the general structure H2C(=CH2)CS. Allyl sulfur compounds Organic compounds Organosulfur compounds Allyl sulfur compounds Aliphatic acyclic compounds Dialkyldisulfides Hydrocarbon derivatives Sulfenyl compounds Aliphatic acyclic compound Allyl sulfur compound Dialkyldisulfide Hydrocarbon derivative Organic disulfide Sulfenyl compound formula C6H12S2 ChemAxon inchi InChI=1S/C6H12S2/c1-4-5-7-8-6(2)3/h4,6H,1,5H2,2-3H3 ChemAxon inchikey BQMYJJMTHCLMRB-UHFFFAOYSA-N ChemAxon