1.0 2026-09-21 23:00:33 UTC 2026-09-21 23:00:33 UTC FDB117232 N,N-Dimethyl-L-Alanine (2S)-2-(dimethylamino)propanoic acid C5H11NO2 117.1463 117.078978601 (2S)-2-(dimethylamino)propanoic acid N,N-dimethyl-L-alanine [H][C@@](C)(N(C)C)C(O)=O InChI=1S/C5H11NO2/c1-4(5(7)8)6(2)3/h4H,1-3H3,(H,7,8)/t4-/m0/s1 QCYOIFVBYZNUNW-BYPYZUCNSA-N belongs to the class of organic compounds known as alanine and derivatives. Alanine and derivatives are compounds containing alanine or a derivative thereof resulting from reaction of alanine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Alanine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives L-alpha-amino acids Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Trialkylamines Alanine or derivatives Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonyl group Carboxylic acid Hydrocarbon derivative L-alpha-amino acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Tertiary aliphatic amine Tertiary amine methyl-L-alanine logp -1.92 ALOGPS logs 0.82 ALOGPS solubility 7.74e+02 g/l ALOGPS logp -2.5 ChemAxon pka_strongest_acidic 1.96 ChemAxon pka_strongest_basic 9.97 ChemAxon iupac (2S)-2-(dimethylamino)propanoic acid ChemAxon average_mass 117.1463 ChemAxon mono_mass 117.078978601 ChemAxon smiles [H][C@@](C)(N(C)C)C(O)=O ChemAxon formula C5H11NO2 ChemAxon inchi InChI=1S/C5H11NO2/c1-4(5(7)8)6(2)3/h4H,1-3H3,(H,7,8)/t4-/m0/s1 ChemAxon inchikey QCYOIFVBYZNUNW-BYPYZUCNSA-N ChemAxon polar_surface_area 40.54 ChemAxon refractivity 30.57 ChemAxon polarizability 12.32 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 6443 Specdb::MsMs 247575 Specdb::MsMs 247576 Specdb::MsMs 247577 Specdb::MsMs 267516 Specdb::MsMs 267517 Specdb::MsMs 267518