1.0 2026-09-22 00:30:16 UTC 2026-09-22 00:30:16 UTC FDB117388 Methyl syringate methyl 4-hydroxy-3,5-dimethoxy-benzoate methyl 4-hydroxy-3,5-dimethoxybenzoate C10H12O5 212.1993 212.068473494 methyl 4-hydroxy-3,5-dimethoxybenzoate syringate COC(=O)C1=CC(OC)=C(O)C(OC)=C1 InChI=1S/C10H12O5/c1-13-7-4-6(10(12)15-3)5-8(14-2)9(7)11/h4-5,11H,1-3H3 ZMXJAEGJWHJMGX-UHFFFAOYSA-N belongs to the class of organic compounds known as gallic acid and derivatives. Gallic acid and derivatives are compounds containing a 3,4,5-trihydroxybenzoic acid moiety. Gallic acid and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Benzoyl derivatives Dimethoxybenzenes Hydrocarbon derivatives M-methoxybenzoic acids and derivatives Methoxyphenols Methyl esters Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds p-Hydroxybenzoic acid alkyl esters Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzoate ester Benzoyl Carboxylic acid derivative Carboxylic acid ester Dimethoxybenzene Ether Gallic acid or derivatives Hydrocarbon derivative M-dimethoxybenzene M-methoxybenzoic acid or derivatives Methoxybenzene Methoxyphenol Methyl ester Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound P-hydroxybenzoic acid alkyl ester P-hydroxybenzoic acid ester Phenol Phenol ether Phenoxy compound benzoate ester dimethoxybenzene phenols logp 1.84 ALOGPS logs -1.90 ALOGPS solubility 2.64e+00 g/l ALOGPS logp 1.36 ChemAxon pka_strongest_acidic 8.44 ChemAxon pka_strongest_basic -4.6 ChemAxon iupac methyl 4-hydroxy-3,5-dimethoxybenzoate ChemAxon average_mass 212.1993 ChemAxon mono_mass 212.068473494 ChemAxon smiles COC(=O)C1=CC(OC)=C(O)C(OC)=C1 ChemAxon formula C10H12O5 ChemAxon inchi InChI=1S/C10H12O5/c1-13-7-4-6(10(12)15-3)5-8(14-2)9(7)11/h4-5,11H,1-3H3 ChemAxon inchikey ZMXJAEGJWHJMGX-UHFFFAOYSA-N ChemAxon polar_surface_area 64.99 ChemAxon refractivity 52.99 ChemAxon polarizability 20.61 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 6050 Specdb::CMs 118777 Specdb::CMs 934003 Specdb::CMs 934004 Specdb::NmrOneD 234338 Specdb::NmrOneD 234339 Specdb::NmrOneD 234340 Specdb::NmrOneD 234341 Specdb::NmrOneD 234342 Specdb::NmrOneD 234343 Specdb::NmrOneD 234344 Specdb::NmrOneD 234345 Specdb::NmrOneD 234346 Specdb::NmrOneD 234347 Specdb::NmrOneD 234348 Specdb::NmrOneD 234349 Specdb::NmrOneD 234350 Specdb::NmrOneD 234351 Specdb::NmrOneD 234352 Specdb::NmrOneD 234353 Specdb::NmrOneD 234354 Specdb::NmrOneD 234355 Specdb::NmrOneD 234356 Specdb::NmrOneD 234357 Specdb::MsMs 244995 Specdb::MsMs 244996 Specdb::MsMs 244997 Specdb::MsMs 264942 Specdb::MsMs 264943 Specdb::MsMs 264944 Specdb::MsMs 3444310 Specdb::MsMs 3444311 Specdb::MsMs 3444312 Specdb::MsMs 3444313 Specdb::MsMs 3444314 Specdb::MsMs 3444315