1.0 2026-09-22 01:16:41 UTC 2026-09-22 01:16:41 UTC FDB117466 3,4-Dimethoxyphenethyl alcohol 2-(3,4-dimethoxyphenyl)ethanol C10H14O3 182.219 182.094294311 2-(3,4-dimethoxyphenyl)ethan-1-ol 2-(3,4-dimethoxyphenyl)ethanol COC1=CC=C(CCO)C=C1OC InChI=1S/C10H14O3/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7,11H,5-6H2,1-2H3 SRQAJMUHZROVHW-UHFFFAOYSA-N belongs to the class of organic compounds known as tyrosols and derivatives. Tyrosols and derivatives are compounds containing a hydroxyethyl group attached to the C4 carbon of a phenol group. Tyrosols and derivatives Organic compounds Benzenoids Phenols Tyrosols and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Dimethoxybenzenes Hydrocarbon derivatives Phenoxy compounds Primary alcohols Alcohol Alkyl aryl ether Anisole Aromatic homomonocyclic compound Dimethoxybenzene Ether Hydrocarbon derivative Methoxybenzene Monocyclic benzene moiety O-dimethoxybenzene Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Primary alcohol Tyrosol derivative logp 1.63 ALOGPS logs -2.01 ALOGPS solubility 1.79e+00 g/l ALOGPS logp 1.18 ChemAxon pka_strongest_acidic 15.89 ChemAxon pka_strongest_basic -2.4 ChemAxon iupac 2-(3,4-dimethoxyphenyl)ethan-1-ol ChemAxon average_mass 182.219 ChemAxon mono_mass 182.094294311 ChemAxon smiles COC1=CC=C(CCO)C=C1OC ChemAxon formula C10H14O3 ChemAxon inchi InChI=1S/C10H14O3/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7,11H,5-6H2,1-2H3 ChemAxon inchikey SRQAJMUHZROVHW-UHFFFAOYSA-N ChemAxon polar_surface_area 38.69 ChemAxon refractivity 50.56 ChemAxon polarizability 19.78 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon